| Revision as of 15:59, 18 January 2011 editThe chemistds (talk | contribs)Extended confirmed users5,761 editsmNo edit summary← Previous edit |
Latest revision as of 14:54, 25 June 2020 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Added FDA UNII |
| (6 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
|
{{DISPLAYTITLE:''trans''-3-Methyl-4-decanolide}} |
|
{{DISPLAYTITLE:''trans''-3-Methyl-4-decanolide}} |
|
{{Chembox |
|
{{Chembox |
|
⚫ |
| verifiedrevid = 408604490 |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| ⚫ |
| verifiedrevid = 407361522 |
|
|
| Name = ''trans''-3-Methyl-4-decanolide |
|
| Name = ''trans''-3-Methyl-4-decanolide |
|
| ImageFile = (R,S)-Trans-3-Methyl-4-decanolide.svg |
|
| ImageFile = (R,S)-Trans-3-Methyl-4-decanolide.svg |
|
⚫ |
| ImageCaption = (4''R'',5''S'')-''trans''-3-Methyl-4-decanolide |
|
| ImageSize = 200px |
|
| ⚫ |
| ImageCaption = (4''R'',5''S'')-''trans''-3-Methyl-4-decanolide |
|
|
| ImageFile1 = (S,R)-Trans-3-Methyl-4-decanolide.svg |
|
| ImageFile1 = (S,R)-Trans-3-Methyl-4-decanolide.svg |
|
⚫ |
| ImageCaption1 = (4''S'',5''R'')-''trans''-3-Methyl-4-decanolide |
|
| ImageSize1 = 200px |
|
| ⚫ |
| ImageCaption1 = (4''S'',5''R'')-''trans''-3-Methyl-4-decanolide |
|
|
| IUPACName = (4''R'',5''S'')-5-Hexyl-4-methyldihydrofuran-2(3''H'')-one<br>(4''S'',5''R'')-5-Hexyl-4-methyldihydrofuran-2(3''H'')-one |
|
| IUPACName = (4''R'',5''S'')-5-Hexyl-4-methyldihydrofuran-2(3''H'')-one<br>(4''S'',5''R'')-5-Hexyl-4-methyldihydrofuran-2(3''H'')-one |
|
| IUPACName_hidden = yes |
|
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 147254-33-9 |
|
| CASNo = 147254-33-9 |
|
| CASNo_Comment = (racemate) |
|
| CASNo_Comment = (racemate) |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = |
|
|
|
| UNII = XN9I5FD92J |
| ⚫ |
| SMILES1 = C1(CCCCCC)OC(C1)=O |
|
|
|
| UNII_Comment = (racemate) |
| ⚫ |
| SMILES1_Comment = (4''R'',5''S'') |
|
|
⚫ |
| PubChem = 12839888 |
| ⚫ |
| SMILES2 = C1(CCCCCC)OC(C1)=O |
|
|
⚫ |
| SMILES1 = C1(CCCCCC)OC(C1)=O |
| ⚫ |
| SMILES2_Comment = (4''S'',5''R'') |
|
|
⚫ |
| SMILES1_Comment = (4''R'',5''S'') |
| ⚫ |
| ChemSpiderID = 24765174 |
|
|
⚫ |
| SMILES2 = C1(CCCCCC)OC(C1)=O |
| ⚫ |
| ChemSpiderID_Comment = (4''S'',5''R'') |
|
|
⚫ |
| SMILES2_Comment = (4''S'',5''R'') |
| ⚫ |
| StdInChI=1S/C11H20O2/c1-3-4-5-6-7-10-9(2)8-11(12)13-10/h9-10H,3-8H2,1-2H3/t9-,10+/m0/s1 |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| StdInChI_Comment = (4''S'',5''R'') |
|
|
⚫ |
| ChemSpiderID = 24765174 |
| ⚫ |
| StdInChIKey= XNRLAEXLQFIKEY-VHSXEESVSA-N |
|
|
| StdInChIKey_Comment = (4''S'',5''R'') |
|
| ChemSpiderID_Comment = (4''S'',5''R'') |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| ChemSpiderID1 = 24765175 |
|
|
⚫ |
| StdInChI=1S/C11H20O2/c1-3-4-5-6-7-10-9(2)8-11(12)13-10/h9-10H,3-8H2,1-2H3/t9-,10+/m0/s1 |
| ⚫ |
| ChemSpiderID1_Comment = (4''R'',5''S'') |
|
|
⚫ |
| StdInChI_Comment = (4''S'',5''R'') |
| ⚫ |
| InChI=1S/C11H20O2/c1-3-4-5-6-7-10-9(2)8-11(12)13-10/h9-10H,3-8H2,1-2H3/t9-,10+/m1/s1 |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| InChI_Comment = (4''R'',5''S'') |
|
|
| InChIKey=XNRLAEXLQFIKEY-ZJUUUORDSA-N |
|
| StdInChIKey= XNRLAEXLQFIKEY-VHSXEESVSA-N |
|
⚫ |
| ChemSpiderID1 = 24765175 |
|
| InChIKey_Comment = (4''R'',5''S'') |
|
|
⚫ |
| ChemSpiderID1_Comment = (4''R'',5''S'') |
|
⚫ |
| InChI=1S/C11H20O2/c1-3-4-5-6-7-10-9(2)8-11(12)13-10/h9-10H,3-8H2,1-2H3/t9-,10+/m1/s1 |
|
⚫ |
| InChI_Comment = (4''R'',5''S'') |
|
⚫ |
| InChIKey=XNRLAEXLQFIKEY-ZJUUUORDSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=11 | H=20 | O=2 |
|
| C=11 | H=20 | O=2 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''''trans''-3-Methyl-4-decanolide''' is a ] with formula {{chem|C|11|H|20|O|2}}, found in ],<ref name=maurer>B. Maurer and A. Mauser (1983), ''New constituents of clary sage oil''. IXth Int. Congr. Essent. Oils, Book 3, pages 69-76</ref>, in the juice of the ], and in the extract of ] peel.<ref name=naef>{{cite journal | author = Regula Naef and Alain Velluz | year = 2005 | title = Identification of trans-3-Methyl-4-Decanolide in Blood Orange Juice and Mandarin Peel | journal = Journal of Essential Oil Research}}</ref> It is a ] with ]-like odor.<ref name=naef/> |
|
'''''trans''-3-Methyl-4-decanolide''' is a ] with formula {{chem|C|11|H|20|O|2}}, found in ],<ref name=maurer>B. Maurer and A. Mauser (1983), ''New constituents of clary sage oil''. IXth Int. Congr. Essent. Oils, Book 3, pages 69-76</ref> in the juice of the ], and in the extract of ] peel.<ref name=naef>{{cite journal | author = Regula Naef and Alain Velluz | year = 2005 | title = Identification of trans-3-Methyl-4-Decanolide in Blood Orange Juice and Mandarin Peel | journal = Journal of Essential Oil Research}}</ref> It is a ] with ]-like odor.<ref name=naef/> |
|
|
|
|
|
The ] is found in an ]n ].<ref name=naef/><ref name=kaiser>R. Kaiser (1993), ''The Scent of Orchids,''page 191. Elsevier</ref> |
|
The ] is found in an ]n ].<ref name=naef/><ref name=kaiser>R. Kaiser (1993), ''The Scent of Orchids,''page 191. Elsevier</ref> |