| Revision as of 14:17, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456775674 of page Trimetrexate for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Latest revision as of 23:10, 1 April 2023 edit Entranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,583 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 470615984 |
|
| Verifiedfields = changed |
|
| ⚫ |
| verifiedrevid = 414586053 |
|
|
| IUPAC_name = 5-methyl-6- quinazoline-2,4-diamine |
|
| IUPAC_name = 5-methyl-6- quinazoline-2,4-diamine |
|
| image = Trimetrexate.svg |
|
| image = Trimetrexate.svg |
|
|
| width = 250 |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|CDI|trimetrexate}} |
|
| Drugs.com = {{drugs.com|CDI|trimetrexate}} |
|
| MedlinePlus = a694019 |
|
| MedlinePlus = a694019 |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = VD: 20-30 Liters |
|
| bioavailability = VD: 20-30 Liters |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = Oxidative O-demethylation, followed by conjugation with glucuronide or sulfate |
|
| metabolism = Oxidative O-demethylation, followed by conjugation with glucuronide or sulfate |
|
| elimination_half-life = 11 to 12 hours |
|
| elimination_half-life = 11 to 12 hours |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 7613 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 52128-35-5 |
|
| CAS_number = 52128-35-5 |
|
| ATC_prefix = P01 |
|
| ATC_prefix = P01 |
|
| ATC_suffix = AX07 |
|
| ATC_suffix = AX07 |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| PubChem = 5583 |
|
| PubChem = 5583 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| Line 34: |
Line 31: |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = UPN4ITI8T4 |
|
| UNII = UPN4ITI8T4 |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D06238 |
|
| KEGG = D06238 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 119 |
|
| ChEMBL = 119 |
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=23 | N=5 | O=3 |
|
| C=19 | H=23 | N=5 | O=3 |
|
| molecular_weight = 369.418 g/mol |
|
|
| smiles = n3c1c(c(c(cc1)CNc2cc(OC)c(OC)c(OC)c2)C)c(nc3N)N |
|
| smiles = n3c1c(c(c(cc1)CNc2cc(OC)c(OC)c(OC)c2)C)c(nc3N)N |
|
| InChI = 1/C19H23N5O3/c1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3/h5-8,22H,9H2,1-4H3,(H4,20,21,23,24) |
|
|
| InChIKey = NOYPYLRCIDNJJB-UHFFFAOYAI |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H23N5O3/c1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3/h5-8,22H,9H2,1-4H3,(H4,20,21,23,24) |
|
| StdInChI = 1S/C19H23N5O3/c1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3/h5-8,22H,9H2,1-4H3,(H4,20,21,23,24) |
| Line 50: |
Line 43: |
|
| StdInChIKey = NOYPYLRCIDNJJB-UHFFFAOYSA-N |
|
| StdInChIKey = NOYPYLRCIDNJJB-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Trimetrexate''' is a ] derivative. It is a ].<ref name="pmid1981548">{{cite journal |vauthors =Wong BK, Woolf TF, Chang T, Whitfield LR |title=Metabolic disposition of trimetrexate, a nonclassical dihydrofolate reductase inhibitor, in rat and dog |journal=Drug Metab. Dispos. |volume=18 |issue=6 |pages=980–6 |year=1990 |pmid=1981548 |url=http://dmd.aspetjournals.org/cgi/pmidlookup?view=long&pmid=1981548}}</ref> |
|
|
|
|
|
==Uses== |
|
|
It has been used with ] in treating ].<ref name="pmid2136905">{{cite journal |vauthors=Sattler FR, Allegra CJ, Verdegem TD, etal |title=Trimetrexate-leucovorin dosage evaluation study for treatment of Pneumocystis carinii pneumonia |journal=J. Infect. Dis. |volume=161 |issue=1 |pages=91–6 |date=January 1990 |pmid=2136905 |doi= 10.1093/infdis/161.1.91}}</ref> |
|
|
|
|
|
It has been investigated for use in treating ].<ref name="pmid11748990">{{cite journal |vauthors =Smith HO, Blessing JA, Vaccarello L |title=Trimetrexate in the treatment of recurrent or advanced leiomyosarcoma of the uterus: a phase II study of the Gynecologic Oncology Group |journal=Gynecol. Oncol. |volume=84 |issue=1 |pages=140–4 |date=January 2002 |pmid=11748990 |doi=10.1006/gyno.2001.6482 }}</ref> |
|
|
It is a ] (MTX) analog that is active against transport-deficient MTX-resistant tumor cells that overcome the acquired and natural resistance to methotrexate. Other uses include skin lymphoma. <ref>Trimetrexate in relapsed T-cell lymphoma with skin involvement. J Clin Oncol. 2002 Jun 15;20(12):2876-80.</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
* {{MedlinePlusDrugInfo|uspdi|202693}} |
|
|
* {{DiseasesDB|30480}} |
|
|
|
|
|
{{Agents against amoebiasis and other protozoal diseases}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{antimicrobial-stub}} |