| Revision as of 15:48, 2 January 2011 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits added chembox← Previous edit |
Latest revision as of 17:58, 2 May 2024 edit undoBernardirfan (talk | contribs)Extended confirmed users10,991 edits Missing links |
| (64 intermediate revisions by 36 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| ImageFile = |
|
|
|
| verifiedrevid = 405508799 |
|
| ImageSize = |
|
|
|
| ImageFileL1 = trinitramide.svg |
| ⚫ |
| IUPACName = N,N-dinitronitramide |
|
|
|
| ImageFileL1_Ref = {{Chemboximage|correct|??}} |
|
| OtherNames = |
|
|
|
| ImageSizeL1 = 121 |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageAltL1 = Structural formula of trinitramide |
| ⚫ |
| CASNo = |
|
|
|
| ImageFileR1 = Trinitramide-3D-spacefill.png |
|
| PubChem = |
|
|
|
| ImageSizeR1 = 121 |
| ⚫ |
| ChemSpiderID = 24751851 |
|
|
|
| ImageAltR1 = Space-filling model of trinitramide |
| ⚫ |
| SMILES = N((=O))((=O))(=O) |
|
|
⚫ |
| IUPACName = ''N'',''N''-Dinitronitramide |
| ⚫ |
| StdInChI=1S/N4O6/c5-2(6)1(3(7)8)4(9)10 |
|
|
|
| OtherNames = {{ubl|Trinitroamine|Trinitroammonia}} |
| ⚫ |
| StdInChIKey = LZLKDWBQTGTOQY-UHFFFAOYSA-N |
|
|
|
| SystematicName = <!-- Trinitroamine (substitutive) OR Trinitronitrogen (additive) --> |
| ⚫ |
}} |
|
|
| Section2 = {{Chembox Properties |
|
|Section1={{Chembox Identifiers |
|
⚫ |
| CASNo = 113282-38-5 |
|
| Formula = N<sub>4</sub>O<sub>6</sub> |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| MolarMass = 152.023 |
|
|
⚫ |
| ChemSpiderID = 24751851 |
|
| Appearance = |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| Density = |
|
|
| MeltingPt = |
|
| PubChem = 57459337 |
|
|
| SMILES = O=N(=O)N(N(=O)=O)N(=O)=O |
|
| BoilingPt = |
|
|
⚫ |
| SMILES1 = N((=O))((=O))(=O) |
|
| Solubility = |
|
|
⚫ |
| StdInChI = 1S/N4O6/c5-2(6)1(3(7)8)4(9)10 |
|
}} |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| Section3 = {{Chembox Hazards |
|
|
⚫ |
| StdInChIKey = LZLKDWBQTGTOQY-UHFFFAOYSA-N |
|
| MainHazards = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}}} |
|
| FlashPt = |
|
|
|
|Section2={{Chembox Properties |
|
| Autoignition = |
|
|
|
| Formula = {{chem2|N(NO2)3}} |
|
}} |
|
|
|
| N=4 | O=6}} |
|
⚫ |
| Section8 = {{Chembox Related |
|
|
| OtherCompounds = {{ubl|]|]|]|]|]}} |
|
⚫ |
}} |
|
}} |
|
}} |
|
'''Trinitramide''' is a compound of ] and ] with the molecular formula N(NO<sub>2</sub>)<sub>3</sub>. The compound was detected and described in 2010 by researchers at the ] (KTH) in ].<ref> |
|
'''Trinitramide''' is a compound of ] and ] with the ] {{chem2|N(NO2)3|auto=1}}. The compound was detected and described in 2010 by researchers at the ] (KTH) in ].<ref name=Rahm>{{cite journal|doi=10.1002/anie.201007047 | pmid=21268214 | volume=50 | issue=5 | title=Experimental Detection of Trinitramide, N(NO2)3 | year=2010 | journal=Angewandte Chemie International Edition | pages=1145–1148 | author=Rahm Martin| s2cid=32952729}}</ref> It is made of a nitrogen atom bonded to three ]s ({{chem2|\sNO2}}). |
|
|
|
|
|
Earlier, there had been speculation whether trinitramide could exist. Theoretical calculations by Montgomery and Michels showed that the compound was likely to be stable.<ref>{{cite journal |title=Structure and stability of trinitramide |author=J. A. Montgomery Jr. and H. H. Michels |journal=] |volume= 97 |issue=26 |pages=6774–6775 |date=July 1993 |accessdate=December 22, 2010 |doi=10.1021/j100128a005}}</ref> |
|
Earlier, there had been speculation{{By whom|date=January 2011}} whether trinitramide could exist.{{Request quotation|date=January 2011}}<!-- it is not clear that this assertion is supported by the end-of-paragraph cite of Montgomery and Michels, 1993. Can we have a short quotation added to the citation, please? --> Theoretical calculations by Montgomery and Michels in 1993 showed that the compound was likely to be stable.<ref>{{cite journal |title=Structure and stability of trinitramide |author=J. A. Montgomery Jr. |author2=H. H. Michels |name-list-style=amp |journal=] |volume= 97 |issue=26 |pages=6774–6775 |date=July 1993 |doi=10.1021/j100128a005}}<!--|accessdate=December 22, 2010 --></ref> |
|
|
|
|
|
|
== Preparation == |
| ⚫ |
Trinitramide has a potential use as one of the most efficient and least polluting of ], as it is ]-free.<ref> http://www.sciencedaily.com/releases/2010/12/101222071831.htm </ref> This is potentially an important development, because the implies that even small improvements in rocket ] can make large improvements in the size of practical rocket launch payloads. |
|
|
|
Trinitramide is prepared by the ] reaction of either potassium dinitramide or ] with ] in ] at low temperatures.<ref name="Rahm" /> |
|
|
|
|
|
|
:{{chem2|+− + +− → N(NO2)3 + +−]]}} |
| ⚫ |
==References== |
|
|
{{reflist}} |
|
|
|
|
|
|
|
== Uses == |
|
{{chem-stub}} |
|
|
⚫ |
Trinitramide has a potential use as one of the most efficient and least polluting of ], as it is ]-free.<ref name=sd20101222>, '']'', 2010-12-22, accessed 2011-01-03.</ref> |
|
|
This is potentially an important development, because the ] implies that even small improvements in ] yields a similar change in ], which can make large improvements in the size of practical rocket launch payloads. |
|
|
The density impulse (impulse per volume) of a trinitramide based propellant could be 20 to 30 percent better than most existing formulations,<ref>{{Cite web | url=http://www.rsc.org/chemistryworld/News/2011/January/07011103.asp | title=New molecule could propel rockets}}</ref> however the ] (impulse per mass) of formulations with ] is higher.<ref name=Rahm/> |
|
|
|
|
|
⚫ |
==References== |
|
] |
|
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{Inorganic-compound-stub}} |
|
] |
|
|
] |
|
|
] |
|
|
] |
|