| Revision as of 01:17, 11 December 2010 edit128.193.29.63 (talk)No edit summary← Previous edit |
Latest revision as of 21:21, 17 February 2021 edit undoCitation bot (talk | contribs)Bots5,390,319 edits Removed parameters. | Use this bot. Report bugs. | Suggested by Wikiminds34 | Category:Vitamins | via #UCB_Category 13/35 |
| (29 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=Trolox.png |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageSize= |
|
|
|
| verifiedrevid = 401706222 |
|
|IUPACName= |
|
|
⚫ |
| ImageFile=Trolox.png |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| ImageSize=200px |
|
⚫ |
| IUPACName=6-Hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid |
|
⚫ |
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo= 53188-07-1 |
|
| CASNo= 53188-07-1 |
| ⚫ |
| PubChem=40634 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=CC1=C(C(=C2CCC(OC2=C1C)(C)C(=O)O)C)O |
|
|
|
| UNII = S18UL9710X |
|
⚫ |
| PubChem=40634 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 82625 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 153 |
|
⚫ |
| SMILES=CC1=C(C(=C2CCC(OC2=C1C)(C)C(=O)O)C)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 37117 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C14H18O4/c1-7-8(2)12-10(9(3)11(7)15)5-6-14(4,18-12)13(16)17/h15H,5-6H2,1-4H3,(H,16,17) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = GLEVLJDDWXEYCO-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=14 | H = 18 | O = 4 |
|
| C=14 | H=18 | O=4 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Trolox''' is ]'s trade name for 6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid, a water-soluble derivative of ]. It is an ], like vitamin E, and is used in biological or biochemical applications to reduce oxidative stress or damage. |
|
'''Trolox''' ('''6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid''') is a water-soluble ] of ] sold by ]. It is an ] like vitamin E and it is used in biological or biochemical applications to reduce oxidative stress or damage. |
|
|
|
|
|
] (TEAC) is a measurement of antioxidant strength based on Trolox, measured in units called Trolox Equivalents (TE), e.g. micromolTE/100 g. Due to the difficulties in measuring individual antioxidant components of a complex mixture (such as blueberries or tomatoes), Trolox equivalency is used as a benchmark for the antioxidant capacity of such a mixture. Trolox equivalency is most often measured using the ] decolorization assay.<ref>Re, R.; Pellegrini, N.; Pannala, A.; Yang, M.; Rice-Evans, C. Antioxidant activity applying an improved ABTS radical cation decolorization assay. Free Radical Biol. Med. 1999, 26, 1231-1237</ref> Other measures include ] (ORAC) and ] (FRAP). |
|
] (TEAC) is a measurement of antioxidant strength based on Trolox, measured in units called Trolox Equivalents (TE), e.g. micromolTE/100 g. Due to the difficulties in measuring individual antioxidant components of a complex mixture (such as blueberries or tomatoes), Trolox equivalency is used as a benchmark for the antioxidant capacity of such a mixture. Trolox equivalency is most often measured using the ] decolorization assay.<ref>R.; Pellegrini, N.; Pannala, A.; Yang, M.; Rice-Evans, C. Antioxidant activity applying an improved ABTS radical cation decolorization assay. Free Radical Biol. Med. 1999, 26, 1231-1237</ref> The TEAC assay is used to measure antioxidant capacity of foods, beverages and supplements. ] (FRAP) is an antioxidant capacity assays which uses Trolox as a standard. |
|
|
|
|
|
|
] (ORAC) used to be an alternative measurement, but the ] (USDA) withdrew these ratings in 2012 as biologically invalid, stating that "The data for antioxidant capacity of foods generated by in vitro (test-tube) methods cannot be extrapolated to in vivo (human) effects and the clinical trials to test benefits of dietary antioxidants have produced mixed results. We know now that antioxidant molecules in food have a wide range of functions, many of which are unrelated to the ability to absorb free radicals" <ref> USDA {{cite web |url=http://www.ars.usda.gov/services/docs.htm?docid=15866 |title=Withdrawn: Oxygen Radical Absorbance Capacity (ORAC) of Selected Foods, Release 2 (2010) |author= |date=16 May 2012 |publisher=United States Department of Agriculture, Agricultural Research Service |access-date=13 June 2012}}</ref> |
|
==Notes== |
|
|
|
|
| ⚫ |
{{reflist}} |
|
|
|
==References== |
|
⚫ |
{{reflist|colwidth=30em}} |
|
|
|
|
|
] |
|
] |
| Line 35: |
Line 53: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
| ⚫ |
] |
|
|
] |
|