| Revision as of 14:33, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457114474 of page Troxacitabine for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 16:44, 12 November 2023 edit Entranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,583 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{one source|date=August 2014}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 411960918 |
|
| verifiedrevid = 470618288 |
|
| IUPAC_name = 4-amino-1-pyrimidin-2(1''H'')-one |
|
| IUPAC_name = 4-amino-1-pyrimidin-2(1''H'')-one |
|
| image = Troxacitabine.svg |
|
| image = Troxacitabine.svg |
|
| width = 200px |
|
| width = 200px |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| metabolism = |
|
| metabolism = |
|
| excretion = |
|
| excretion = |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
⚫ |
| CAS_number = 145918-75-8 |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
⚫ |
| ATC_suffix = |
| ⚫ |
| CAS_number = <!-- blanked - oldvalue: 145918-75-8 --> |
|
| ⚫ |
| ATC_suffix = |
|
|
| PubChem = 151173 |
|
| PubChem = 151173 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 399955 |
|
| ChemSpiderID = 399955 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 60KQZ0388Y |
|
| UNII = 60KQZ0388Y |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 359164 |
|
| ChEMBL = 359164 |
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=8 | H=11 | N=3 | O=4 |
|
| C=8 | H=11 | N=3 | O=4 |
|
| molecular_weight = 213.19 g/mol |
|
|
| smiles = O=C1/N=C(/N)\C=C/N12O(OC2)CO |
|
| smiles = O=C1/N=C(/N)\C=C/N12O(OC2)CO |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 41: |
Line 37: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RXRGZNYSEHTMHC-BQBZGAKWSA-N |
|
| StdInChIKey = RXRGZNYSEHTMHC-BQBZGAKWSA-N |
|
| synonyms = |
|
| synonyms = |
|
}} |
|
}} |
|
|
|
|
|
'''Troxacitabine''' (brand name '''Troxatyl''') is a ] with anticancer activity. Its use is being studied in patients with refractory ]s.<ref>{{cite journal | vauthors = Vose JM, Panwalkar A, Belanger R, Coiffier B, Baccarani M, Gregory SA, Facon T, Fanin R, Caballero D, Ben-Yehuda D, Giles F | display-authors = 6 | title = A phase II multicenter study of troxacitabine in relapsed or refractory lymphoproliferative neoplasms or multiple myeloma | journal = Leukemia & Lymphoma | volume = 48 | issue = 1 | pages = 39–45 | date = January 2007 | pmid = 17325846 | doi = 10.1080/10428190600909578 | s2cid = 36220728 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
|
|
|
{{Pharma-stub}} |