| Revision as of 14:36, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 470546122 of page Tuftsin for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 19:37, 27 September 2023 edit Wprlh (talk | contribs)Extended confirmed users21,401 edits →Nontoxicity for animals and humans: Fixed typosTags: Mobile edit Mobile web edit |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 444238690 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Tuftsin.svg |
|
|
⚫ |
| verifiedrevid = 470618689 |
| ⚫ |
|ImageSize=250px |
|
|
⚫ |
| ImageFile=Tuftsin.svg |
|
|IUPACName= |
|
|
⚫ |
| ImageSize=250px |
| ⚫ |
|OtherNames= |
|
|
|
| IUPACName=<small>L</small>-threonyl-<small>L</small>-lysyl-<small>L</small>-prolyl-<small>L</small>-arginine |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames= |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| ChemSpiderID = 21106486 |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| InChI = 1/C21H40N8O6/c1-12(30)16(23)18(32)27-13(6-2-3-9-22)19(33)29-11-5-8-15(29)17(31)28-14(20(34)35)7-4-10-26-21(24)25/h12-16,30H,2-11,22-23H2,1H3,(H,27,32)(H,28,31)(H,34,35)(H4,24,25,26)/t12-,13?,14?,15+,16?/m1/s1 |
|
|
⚫ |
| ChemSpiderID = 21244387 |
| ⚫ |
| InChIKey = IESDGNYHXIOKRW-GVNIGQRWBS |
|
|
⚫ |
| SMILES = O=C(N(CCCNC(N)=N)C(O)=O)1CCCN1C(=O)(CCCCN)NC(=O)(N)(C)O |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChI = 1S/C21H40N8O6/c1-12(30)16(23)18(32)27-13(6-2-3-9-22)19(33)29-11-5-8-15(29)17(31)28-14(20(34)35)7-4-10-26-21(24)25/h12-16,30H,2-11,22-23H2,1H3,(H,27,32)(H,28,31)(H,34,35)(H4,24,25,26)/t12-,13?,14?,15+,16?/m1/s1 |
|
|
⚫ |
| StdInChI = InChI=1S/C21H40N8O6/c1-12(30)16(23)18(32)27-13(6-2-3-9-22)19(33)29-11-5-8-15(29)17(31)28-14(20(34)35)7-4-10-26-21(24)25/h12-16,30H,2-11,22-23H2,1H3,(H,27,32)(H,28,31)(H,34,35)(H4,24,25,26)/t12-,13+,14+,15+,16+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChIKey = IESDGNYHXIOKRW-GVNIGQRWSA-N |
|
|
⚫ |
| StdInChIKey = IESDGNYHXIOKRW-YXMSTPNBSA-N |
|
| CASNo = <!-- blanked - oldvalue: 9063-57-4 --> |
|
|
|
| CASNo_Ref = {{cascite|changed|??}} |
| ⚫ |
| PubChem=24780 |
|
|
|
| CASNo=9063-57-4 |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
⚫ |
| PubChem=24780 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = QF5336J16C |
|
| UNII = QF5336J16C |
|
⚫ |
| MeSHName=Tuftsin |
| ⚫ |
| SMILES = O=C(NC(CCCNC(N)=N)C(O)=O)1CCCN1C(=O)C(CCCCN)NC(=O)C(N)(C)O |
|
| ⚫ |
| MeSHName=Tuftsin |
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>21</sub>H<sub>40</sub>N<sub>8</sub>O<sub>6</sub> |
|
| Formula=C<sub>21</sub>H<sub>40</sub>N<sub>8</sub>O<sub>6</sub> |
|
| MolarMass=500.593 g/mol |
|
| MolarMass=500.593 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Tuftsin''' is a ] (Thr-Lys-Pro-Arg, TKPR) located in the ] of the heavy chain of ] (residues 289-292). It has an immunostimulatory effect. It is named for ] where it was first discovered in 1983.<ref name=Najjar1983>Najjar, V.A. Tuftsin, a natural activator of phagocyte cells: an overview. Ann. New York Acad. Sci. 1–11 (1983)</ref> |
|
|
|
|
|
==Formation== |
|
|
Two enzymes are needed to release tuftsin from immunoglobulin G.<ref name=Najjar1983/>First, the ] enzyme tuftsin-endocarboxypeptidase nicks the heavy chain at the Arg-Glu bond (292-293). The arginine carboxy-terminal is now susceptible to the action of the second enzyme, ] β. The leukokinin-S so nicked is present in tissues and blood, free or bound to outer membrane of the appropriate phagocyte. The membrane enzyme leukokininase acts on the bound leukokinin-S to cleave it at the amino end of threonine between residues 288 and 289 (-Lys-Thr-). Free tuftsin is biologically active. The phagocytic cell plays a unique role in releasing its own activator. Leukokininase can be found on the outer membrane of phagocytic cells: blood ] leukocytes of human and dog, rabbit peritoneal ]. It is a highly active enzyme with pH optimum:6.8.<ref name=Fridkin>Fridkin, M. & Najjar, V.A. Tuftsin: Its Chemistry, Biology and Clinical Potential. Crit. Rev. Biochem. Mol. Biol. 24, 1–40 (1989)</ref> |
|
|
|
|
|
==Function== |
|
|
|
|
|
===Phagocytosis=== |
|
|
Half-maximum stimulation is attained at about 100 nM. Stimulation of ] is obtained with polymorphonuclear leukocyte (PMN) cells from human, dog, rabbit and cow as well as with macrophages from the lung and ] of mice, and guinea pig and mouse ] cells. This effect is inhibited by peptide analogue Thr-Lys-Pro-Pro-Arg.<ref name=Fridkin/> Basal activity is not inhibited, so basal phagocytosis may follow a different pathway from that which follows stimulation.<ref name=Najjar1983/> Stimulation of ] is exerted only on phagocytic cells, not on cultured cell line mouse leukemia.<ref name=Fridkin/> |
|
|
|
|
|
===Motility and chemotaxis=== |
|
|
The vertical ] of neutrophils in capillary tubes is stimulated by tuftsin, stimulation is inhibited by Thr-Lys-Pro-Pro-Arg. The tuftsin analogue Thr-Pro-Lys-Arg failed to show stimulation.<ref name=Fridkin/> |
|
|
|
|
|
===Formation of reactive oxygen compounds=== |
|
|
Tuftsin augments the formation of O<sub>2</sub><sup>−</sup> and H<sub>2</sub>O<sub>2</sub> to a considerable extent without the need for particle phagocytosis. Experiments showed rapid response to various concentrations of tuftsin. The optimum concentration was at 375 nM. This response to tuftsin stimulation of macrophage accounts for about 90% of the superoxide formed through the xanthine oxidase system.<ref name=Fridkin/> |
|
|
|
|
|
===Augmentation of Tumor Necrosis Factor=== |
|
|
Injection of tuftsin intraperitoneally increases the formulation of ] in serum and supernatants of cultured splenic and peritoneal adherent cells. This was also demonstrated ''in vitro'' using HL60 leukemia cells.<ref name=Fridkin/> |
|
|
|
|
|
===Immunmodulating activity=== |
|
|
Tuftsin acts at the level of ]. Antigen uptake by ] is enhanced when a given antigen is processed in the presence of tuftsin. Maximal effect was measured at tuftsin concentration 5 x 10<sup>−8</sup> M. This process is highly specific and dependent on the structural integrity of tuftsin. Tuftsin-antigen complexes are very immunogenic.<ref name=Fridkin/> The number of antigen-forming cells increases following injections of tuftsin T-dependent antigen.<ref name=Najjar1983/> Tuftsin enhances the antigen-dependent cell-mediated immunity. Spleen cell cytotoxicity is augmented to a significant degree.<ref name=Fridkin/> |
|
|
|
|
|
===Effect of cell cytotoxicity=== |
|
|
The enhancement of antitumour immune response by immunomodulators is capable of stimulating reticuloendothelial and T-cell-mediated tumour destruction. The effect of tuftsin on augmentation of cellular cytotoxicity was evaluated both ''in vitro'' and ''in vivo''.<ref name=Fridkin/> |
|
|
|
|
|
===Nontoxicity for animals and humans=== |
|
|
In different animal models, tuftsin showed no toxicity when administered intravenously or intraperitoneally. In a phase I study, tuftsin was shown to be nontoxic in adult human patients with advanced cancer when it was injected once intravenously (0.96 mg/kg body weight). Extensive augmentation of white blood counts and enhanced cytotoxicity of lymphocytes was notable. No detectable tuftsin-related toxicity was noticed in human patients during a phase II study, where the peptide was injected intravenously twice a week at total doses of 5 mg per injection.<ref name=Fridkin/> |
|
|
|
|
|
==Pathology== |
|
|
Tuftsin deficiency can be hereditary<ref name=Najjar1983/> or can occur following ], resulting in increased susceptibility to certain diseases e.g.: infected eczematous dermatitis with draining lymph nodes, ] and ]. Acquired tuftsin deficiency can occur in granulocyte leukemia, when blood neutrophils failed to show stimulation with synthetic tuftsin or with the serum leukokinin. Serum level of tuftsin was minimal or absent.<ref name=Fridkin/> |
|
|
|
|
|
==Clinical significance== |
|
|
Poly- or oligotuftsin derivatives can be used as delivery systems. For example, a 35-40 unit repeat was used as a carrier for the preparation of synthetic immunogens in malaria vaccines against ''Plasmodium falciparum''.<ref>Siemion, I. Z. & Kluczyk, A. Tuftsin: On the 30-year anniversary of Victor Najjar’s discovery. Peptides 20, 645–674 (1999)</ref> Tuftsin enhances the action of rifampicin-bearing liposomes in the treatment of tuberculosis, and that amphotericin B-bearing liposomes in the treatment of human aspergillosis in mice. Conjugates with polytuftsin retain tuftsin-like effects and increase the epitope specific antibody production.<ref>Gábor, M. et al. Synthesis, Conformation, and Immunoreactivity of New Carrier Molecules Based on Repeated Tuftsin-Like Sequence. Biopolymers 73, 000–000 (2004)</ref> |
|
|
|
|
|
==Tuftsin analogues== |
|
|
Tuftsin sequence appears in all four classes of IgG. However, only leukokinin, a small fraction of IgG1, displays tuftsin activity. Tuftsin occurs in guinea pig IgG2 exactly in the same position. The mouse IgG1 analogue is a tetrapeptide Thr-Gln-Pro-Arg (TQPR) at the same place, one base change at the first base of the triplet code. Tuftsin sequence appears in residues 9-12 from the amino terminal of p12 protein of Rauscher murine leukemia virus. The tetrapeptide Thr-Arg-Pro-Lys (TRPK) is in the influenza ] virus protein, residues 214–217. The canine analogue is the tetrapeptide Thr-Lys-Pro-Lys (TKPK).<ref name=Najjar1983/> The peptide Thr-Arg-Pro-Arg (TRPR) is a biologically active pancreatic polypeptide 32–35 with gastrointestinal functions. Thr-Arg-Pro-Arg, Thr-Lys-Pro-Lys, Thr-Arg-Pro-Lys are as active as Thr-Lys-Pro-Arg. Thr-Lys-Pro-Pro-Arg (TKPPR) is a potent inhibitor. Lys-Pro-Pro-Arg (KPPR) is also an inhibitor of phagocytosis, superoxide anion production and chemotaxis both human and rat PMN leukocytes and monocytes. Tyr-Lys-Pro exert considerable regulatory effect on several macrophage functions including: phagocytosis, cell locomotion, superoxide anion production, IgE-dependent cellular cytotoxicity, β-glycuronidase release, and ] production.<ref name=Fridkin/> |
|
|
|
|
|
] is an elongated version of tuftsin with a Pro-Gly-Pro appended, i.e. Thr-Lys-Pro-Arg-Pro-Gly-Pro (TKPRPGP). It has been claimed to have ] and ] effects and is used in ] and other former Soviet bloc countries. |
|
|
|
|
|
==References== |
|
|
<references /> |
|
|
|
|
|
] |