| Revision as of 13:57, 13 September 2010 editRjwilmsi (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers932,009 editsm clean up using AWB (7118)← Previous edit |
Latest revision as of 13:42, 16 October 2022 edit undo147.147.108.194 (talk) Removing advertisingTag: references removed |
| (24 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=U46619.png |
|
|
|
| verifiedrevid = 425029276 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile=U46619.png |
| ⚫ |
|IUPACName=(''Z'')-7--3-oxabicycloheptan-6-yl]hept-5-enoic acid |
|
|
⚫ |
| ImageSize=200px |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| PIN=(5''Z'')-7-<nowiki/>{(1''R'',4''S'',5''S'',6''R'')-6--2-oxabicycloheptan-5-yl}hept-5-enoic acid |
|
⚫ |
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=56985-40-1 |
|
| CASNo=56985-40-1 |
|
| PubChem=5311493 |
|
| PubChem=5311493 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 357834 |
|
| IUPHAR_ligand = 1888 |
|
| IUPHAR_ligand = 1888 |
|
| SMILES=CCCCC(O)/C=C/12OC(C2)1C/C=C\CCCC(O)=O |
|
| SMILES=CCCCC(O)/C=C/12OC(C2)1C/C=C\CCCC(O)=O |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>21</sub>H<sub>34</sub>O<sub>4</sub> |
|
| Formula=C<sub>21</sub>H<sub>34</sub>O<sub>4</sub> |
|
| MolarMass=350.49 g/mol |
|
| MolarMass=350.49 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''U46619''' is a stable synthetic ] of the ] PGH<sub>2</sub> first prepared in 1975.<ref>{{cite journal | author = Bundy, G. L. | title = Synthesis of prostaglandin endoperoxide analogs | journal = Tetrahedron Letters | year = 1975 | volume = 24 | pages = 1957–1960 | doi = 10.1016/S0040-4039(00)72333-1}}</ref> U46619 is a ] that mimics the hydroosmotic effect of ].<ref>{{cite journal | title = Calcium-45 fluxes in isolated toad bladder epithelial cells: effects of agents which alter water or sodium transport | author = Burch, Ronald M.; Halushka, Perry V. | journal = Journal of Pharmacology and Experimental Therapeutics |year=1983|volume =224|issue=1|pages= 108–17 | pmid = 6294273}}</ref> It also mimics the effects of ] by activating ].<ref>{{cite journal | title = Activation of human platelet phospholipase C by ionophore A23187 is totally dependent upon cyclo-oxygenase products and ADP | author = Rittenhouse, Susan E. | journal = Biochemical Journal |year=1984 | volume = 222 | issue = 1 | pages = 103–110 | pmid = 6433894 | pmc = 1144149}}</ref><ref>{{cite journal|title=Thromboxane A2-induced contraction of rat caudal arterial smooth muscle involves activation of Ca2+ entry and Ca2+sensitization: Rho-associated kinase-mediated phosphorylation of MYPT1 at Thr-855 but not Thr-697|author=Michael P. Walsh, et all|url=http://biosupport.licor.com/docs/2005/BJ20050237.pdf}}</ref> |
|
'''U46619''' is a stable synthetic ] of the endoperoxide ] PGH<sub>2</sub> first prepared in 1975,<ref>{{cite journal | author = Bundy, G. L. | title = Synthesis of prostaglandin endoperoxide analogs | journal = Tetrahedron Letters | year = 1975 | volume = 16 | pages = 1957–1960 | doi = 10.1016/S0040-4039(00)72333-1 | issue = 24}}</ref> and acts as a thromboxane A<sub>2</sub> (TP) receptor agonist. It potently stimulates TP receptor-mediated, but not other prostaglandin receptor-mediated responses in various in vitro preparations and exhibits many properties similar to thromboxane A<sub>2</sub>, including shape change and aggregation of platelets <ref>{{cite journal | title=Binding of a thromboxane A2/prostaglandin H2 agonist U46619 to washed human platelets |author1=Liel, N. |author2=Mais, D.E. |author3=Halushka, P.V | journal = Prostaglandins | year=1987 |volume=33|issue=6 |pages= 789–797 | doi=10.1016/0090-6980(87)90107-9|pmid=2959986 }}</ref> and smooth muscle contraction. U46619 is a ] that mimics the hydroosmotic effect of ].<ref>{{cite journal | title = Calcium-45 fluxes in isolated toad bladder epithelial cells: effects of agents which alter water or sodium transport |author1=Burch, Ronald M. |author2=Halushka, Perry V. | journal = Journal of Pharmacology and Experimental Therapeutics |year=1983|volume =224|issue=1|pages= 108–17 | pmid = 6294273}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{Reflist|2}} |
|
|
|
|
|
{{Prostanoidergics}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Molecular-biology-stub}} |