| Revision as of 20:12, 20 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wik← Previous edit |
Latest revision as of 20:03, 20 December 2023 edit undoJJMC89 bot III (talk | contribs)Bots, Administrators3,681,571 editsm Moving Category:Pfizer brands to Category:Drugs developed by Pfizer per Misplaced Pages:Categories for discussion/Log/2023 December 9#Category:AstraZeneca brands |
| (24 intermediate revisions by 22 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Female sexual arousal disorder medication}} |
|
|
{{Use dmy dates|date=February 2015}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 443609801 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = (R)-2-({1-cyclopentyl}methyl)valeric acid |
|
|
⚫ |
| verifiedrevid = 451558838 |
| ⚫ |
| image = UK-414,495_structure.png |
|
|
⚫ |
| IUPAC_name = (2''R'')-2-({1-cyclopentyl}methyl)pentanoic acid |
| ⚫ |
| width = 240 |
|
|
⚫ |
| image = UK-414,495.svg |
|
⚫ |
| width = |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| licence_EU = |
|
| licence_EU = |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_UK = |
|
| legal_UK = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 337962-93-3 |
|
| CAS_number = 337962-93-3 |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 9949799 |
|
| PubChem = 9949799 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 378763 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = JV29CG9MQ2 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 8125410 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=16 | H=25 | N=3 | O=3 | S=1 |
|
| C=16 | H=25 | N=3 | O=3 | S=1 |
|
|
| smiles = CCC(CC1(CCCC1)C(=O)NC2=NN=C(S2)CC)C(=O)O |
|
| molecular_weight = 339.452 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| smiles = CCc1nnc(s1)NC(=O)C2(CC(C(O)=O)CCC)CCCC2 |
|
|
|
| StdInChI = 1S/C16H25N3O3S/c1-3-7-11(13(20)21)10-16(8-5-6-9-16)14(22)17-15-19-18-12(4-2)23-15/h11H,3-10H2,1-2H3,(H,20,21)(H,17,19,22)/t11-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = FWXXCSISWQQOGS-LLVKDONJSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''UK-414,495''' is a drug developed by ] for the treatment of ].<ref></ref> UK-414,495 acts as a potent, selective inhibitor of the enzyme ], which normally serves to break down the ] ]. The consequent increase in VIP activity alters blood flow to the genital region leading to increased lubrication and muscle relaxation.<ref name="pmid16550257">{{cite journal |author=Armer R, Warne P, Witherington J |title=Recent disclosures of clinical drug candidates |journal=Drug News & Perspectives |volume=19 |issue=1 |pages=65–72 |year=2006 |pmid=16550257 |doi= |url=}} ISSN 0214-0934</ref><ref>{{Cite doi|10.1111/j.1476-5381.2010.00693.x}}</ref><ref>{{Cite doi|10.1111/j.1476-5381.2010.00691.x}}</ref> |
|
'''UK-414,495''' is a drug developed by ] for the treatment of ]. UK-414,495 acts as a potent, selective inhibitor of the enzyme ], which normally serves to break down the ] ]. The consequent increase in VIP activity alters blood flow to the genital region leading to increased lubrication and muscle relaxation.<ref name="pmid16550257">{{cite journal | vauthors = Armer R, Warne P, Witherington J | title = Recent disclosures of clinical drug candidates | journal = Drug News & Perspectives | volume = 19 | issue = 1 | pages = 65–72 | year = 2006 | pmid = 16550257 }}</ref><ref>{{cite journal | vauthors = Angulo J | title = Neutral endopeptidase inhibition: could it have a role in the treatment of female sexual arousal disorder? | journal = British Journal of Pharmacology | volume = 160 | issue = 1 | pages = 48–50 | date = May 2010 | pmid = 20412067 | pmc = 2860205 | doi = 10.1111/j.1476-5381.2010.00693.x }}</ref><ref>{{cite journal | vauthors = Wayman CP, Baxter D, Turner L, Van Der Graaf PH, Naylor AM | title = UK-414,495, a selective inhibitor of neutral endopeptidase, potentiates pelvic nerve-stimulated increases in female genital blood flow in the anaesthetized rabbit | journal = British Journal of Pharmacology | volume = 160 | issue = 1 | pages = 51–59 | date = May 2010 | pmid = 20412068 | pmc = 2860206 | doi = 10.1111/j.1476-5381.2010.00691.x }}</ref> |
|
|
|
|
|
==See also== |
|
== See also == |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
| Line 38: |
Line 52: |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
| Line 47: |
Line 61: |
|
== References == |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
{{pharm-stub}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{genito-urinary-drug-stub}} |