| Revision as of 20:01, 10 September 2011 editPotatoBot (talk | contribs)Bots51,239 editsm Stub sorting and placement of stub template(s): musculoskeletal-drug-stub. See approval. Report errors and suggestions at User talk:PotatoBot.← Previous edit |
Latest revision as of 10:20, 29 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers171,905 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (13 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443602451 |
|
| verifiedrevid = 449588246 |
|
| IUPAC_name = butyl 2-(amino)benzoate |
|
| IUPAC_name = Butyl 2-(amino)benzoate |
|
| image = Ufenamate.png |
|
| image = Ufenamate.png |
|
|
|
|
| Line 25: |
Line 27: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 67330-25-0 |
|
| CAS_number = 67330-25-0 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
| Line 36: |
Line 39: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D01823 |
|
| KEGG = D01823 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 5430 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=18 | H=18 | F=3 | N=1 | O=2 |
|
| C=18 | H=18 | F=3 | N=1 | O=2 |
|
| molecular_weight = 337.33 g/mol |
|
|
| smiles = CCCCOC(=O)C1=CC=CC=C1NC2=CC=CC(=C2)C(F)(F)F |
|
| smiles = CCCCOC(=O)C1=CC=CC=C1NC2=CC=CC(=C2)C(F)(F)F |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C18H18F3NO2/c1-2-3-11-24-17(23)15-9-4-5-10-16(15)22-14-8-6-7-13(12-14)18(19,20)21/h4-10,12,22H,2-3,11H2,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = JDLSRXWHEBFHNC-UHFFFAOYSA-N |
|
|
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Ufenamate''' (]) is a topical analgesic.<ref>{{cite journal | vauthors = Iino H, Fujii M, Fujino M, Koizumi N, Watanabe Y | title = Penetration of Ufenamate into Intact, Stripped, or Delipidized Skin Using Different Vehicles | journal = Biological & Pharmaceutical Bulletin | volume = 38 | issue = 10 | pages = 1645–8 | year = 2015 | pmid = 26424024 | doi = 10.1248/bpb.b15-00267 | doi-access = free }}</ref> |
|
'''Ufenamate''' (]) is a topical analgesic. |
|
|
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{musculoskeletal-drug-stub}} |
|
{{musculoskeletal-drug-stub}} |
|
|
|
|
|
] |
|
|
] |