| Revision as of 02:21, 21 January 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drugbox valid← Previous edit |
Latest revision as of 12:29, 26 November 2024 edit undoAnomieBOT (talk | contribs)Bots6,550,803 editsm Dating maintenance tags: {{Onesource}} |
| (27 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Unreferenced stub|auto=yes|date=December 2009}} |
|
|
|
{{onesource|date=November 2024}} |
| ⚫ |
{{Drugbox |
|
|
|
|
|
⚫ |
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 385687149 |
|
| verifiedrevid = 409092073 |
|
| IUPAC_name = 5--1H-pyrimidine-2,4-dione |
|
| IUPAC_name = 5--1''H''-pyrimidine-2,4-dione |
|
| image = uramustine.svg |
|
| image = Uramustine.svg |
|
|width = 200px |
|
|
| CAS_number = 66-75-1 |
|
| width = 175 |
|
|
|
|
| CASNo_Ref = {{cascite}} |
|
|
|
<!--Clinical data--> |
| ⚫ |
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
| tradename = |
|
⚫ |
| pregnancy_category = |
| ⚫ |
| ATC_supplemental = |
|
|
⚫ |
| legal_status = |
| ⚫ |
| PubChem = 6194 |
|
|
⚫ |
| routes_of_administration = |
| ⚫ |
| DrugBank = APRD00130 |
|
|
|
|
| ⚫ |
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
|
| protein_bound = 5% |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 7621 |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 66-75-1 |
|
⚫ |
| ATC_prefix = L01 |
|
|
| ATC_suffix = AD08 |
|
⚫ |
| ATC_supplemental = |
|
⚫ |
| PubChem = 6194 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
⚫ |
| DrugBank = DB00791 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = W7KQ46GJ8U |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D06265 |
|
| KEGG = D06265 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| C = 8 |H = 11 |Cl = 2 |N = 3 |O = 2 |
|
|
|
| ChEMBL = 1488 |
|
| molecular_weight = 252.097 ]/] |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| bioavailability = |
|
|
| protein_bound = 5% |
|
| ChemSpiderID = 5959 |
|
|
| SMILES = O=C1C(\N(CCCl)CCCl)=C/NC(=O)N1 |
| ⚫ |
| metabolism = |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| elimination_half-life = |
|
|
|
| StdInChI = 1S/C8H11Cl2N3O2/c9-1-3-13(4-2-10)6-5-11-8(15)12-7(6)14/h5H,1-4H2,(H2,11,12,14,15) |
| ⚫ |
| excretion = ] |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| pregnancy_category = |
|
|
|
| StdInChIKey = IDPUKCWIGUEADI-UHFFFAOYSA-N |
| ⚫ |
| legal_status = |
|
|
|
|
| ⚫ |
| routes_of_administration = }} |
|
|
|
<!--Chemical data--> |
| ⚫ |
'''Uramustine''' (]) or '''uracil mustard''' is a ] ] which belongs to the class of ]s. It is used in ]atic malignancies such as ]. It works by damaging ], primarily in ] cells that preferentially take up the ] due to their need to make ] during their rapid cycles of ]. The DNA damage leads to ] of the affected cells. ] suppression and nausea are the main side effects. |
|
|
⚫ |
| C=8 | H=11 | Cl=2 | N=3 | O=2 |
|
|
}} |
|
|
|
|
⚫ |
'''Uramustine''' (]) or '''uracil mustard''' is a ] ] which belongs to the class of ]s.<ref>{{cite book | vauthors = Ghorani-Azam A, Balali-Mood M | chapter = Clinical pharmacology and toxicology of mustard compounds. | veditors = Balali-Mood M, Abdollahi M |title=Basic and clinical toxicology of mustard compounds |date=2015 |publisher=Springer |location=Cham |isbn=978-3-319-23874-6 |page=74 | chapter-url=https://books.google.com/books?id=MGkiCwAAQBAJ&dq=Uramustine&pg=PA74}}</ref> It is used in ]atic malignancies such as ]. It works by damaging ], primarily in ] cells that preferentially take up the ] due to their need to make ] during their rapid cycles of ]. The DNA damage leads to ] of the affected cells. ] suppression and nausea are the main side effects. |
|
|
|
|
⚫ |
Chemically it is a derivative of ] and ]. |
|
|
|
|
|
|
==References== |
| ⚫ |
Chemically it is a derivative of ] and ]. |
|
|
|
{{Reflist}} |
|
|
|
|
|
{{Chemotherapeutic agents}} |
|
{{Chemotherapeutic agents}} |
|
|
|
|
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{antineoplastic-drug-stub}} |
|
{{antineoplastic-drug-stub}} |