Misplaced Pages

Uridine diphosphate glucose: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 10:34, 30 July 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL.← Previous edit Latest revision as of 00:46, 8 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name 
(22 intermediate revisions by 17 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| verifiedrevid = 402840252 | verifiedrevid = 470620377
| ImageFile = UDP-Glucose.svg | ImageFile = UDP-Glucose.svg
| ImageSize = 200px | ImageSize =
| IUPACName = Uridine 5′-(α-<small>D</small>-glucopyranosyl dihydrogen diphosphate)
| IUPACName = <nowiki>methoxy-hydroxyphosphoryl] hydrogen | SystematicName = ''O''<sup>1</sup>-<nowiki/>{methyl} ''O''<sup>3</sup>- dihydrogen diphosphate
phosphate
| OtherNames = UDP-glucose | OtherNames = UDP-glucose
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8308 | ChemSpiderID = 8308
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 375951 | ChEMBL = 375951
| InChI = 1/C15H24N2O17P2/c18-3-5-8(20)10(22)12(24)14(32-5)33-36(28,29)34-35(26,27)30-4-6-9(21)11(23)13(31-6)17-2-1-7(19)16-15(17)25/h1-2,5-6,8-14,18,20-24H,3-4H2,(H,26,27)(H,28,29)(H,16,19,25)/t5-,6-,8-,9-,10+,11-,12-,13-,14-/m1/s1 | InChI = 1/C15H24N2O17P2/c18-3-5-8(20)10(22)12(24)14(32-5)33-36(28,29)34-35(26,27)30-4-6-9(21)11(23)13(31-6)17-2-1-7(19)16-15(17)25/h1-2,5-6,8-14,18,20-24H,3-4H2,(H,26,27)(H,28,29)(H,16,19,25)/t5-,6-,8-,9-,10+,11-,12-,13-,14-/m1/s1
Line 16: Line 17:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HSCJRCZFDFQWRP-JZMIEXBBSA-N | StdInChIKey = HSCJRCZFDFQWRP-JZMIEXBBSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 133-89-1 | CASNo = 133-89-1
| UNII_Ref = {{fdacite|correct|FDA}}
⚫ | PubChem = 8629
| UNII = V50K1D7P4Y
⚫ | PubChem = 8629
| IUPHAR_ligand = 1783 | IUPHAR_ligand = 1783
| ChEBI_Ref = {{ebicite|correct|EBI}}
⚫ | SMILES = O=P(O1O((O)(O)1O)CO)(O)OP(=O)(O)OC3O(N2/C=C\C(=O)NC2=O)(O)3O
| ChEBI = 52249
⚫ | MeSHName = Uridine+Diphosphate+Glucose
⚫ | SMILES = O=P(O1O((O)(O)1O)CO)(O)OP(=O)(O)OC3O(N2/C=C\C(=O)NC2=O)(O)3O
⚫ | MeSHName = Uridine+Diphosphate+Glucose
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = C<sub>15</sub>H<sub>24</sub>N<sub>2</sub>O<sub>17</sub>P<sub>2</sub> | Formula = C<sub>15</sub>H<sub>24</sub>N<sub>2</sub>O<sub>17</sub>P<sub>2</sub>
| MolarMass = 566.302 g/mol | MolarMass = 566.302 g/mol
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = | MeltingPt =
| BoilingPt = | BoilingPt =
}} }}
| Section3 = {{Chembox Hazards | Section3 = {{Chembox Hazards
| Solubility = | MainHazards =
| MainHazards = | FlashPt =
| FlashPt = | AutoignitionPt =
| Autoignition =
}} }}
}} }}
Line 41: Line 46:


==Functions== ==Functions==
It is used in ] as an activated form of glucose as a substrate for enzymes called ]s.<ref>{{cite journal |author=Rademacher T, Parekh R, Dwek R |title=Glycobiology |journal=Annu Rev Biochem |volume=57 |issue= |pages=785–838 |year=1988 |pmid=3052290 |doi=10.1146/annurev.bi.57.070188.004033}}</ref> UDP-glucose is used in ] as an activated form of glucose, a substrate for enzymes called ]s.<ref>{{cite journal |vauthors=Rademacher T, Parekh R, Dwek R |title=Glycobiology |journal=Annu Rev Biochem |volume=57 |pages=785–838 |year=1988 |pmid=3052290 |doi=10.1146/annurev.bi.57.070188.004033}}</ref>


It is a precursor of ] and can be converted into ] and ], which can then be used as substrates by the enzymes that make ]s containing ] and ]. UDP-glucose is a precursor of ] and can be converted into ] and ], which can then be used as substrates by the enzymes that make ]s containing ] and ].


UDP-glucose can also be used as a precursor of sucrose ]s, and ]s. UDP-glucose can also be used as a precursor of sucrose, ]s and ]s.


==Components== ==Components==
UDP-glucose consists of the ] ], the ] ] ], ], and the ] ]. UDP-glucose consists of the ] group, ], ], and ].

⚫ ==References==
⚫ {{reflist}}


== See also == == See also ==
* ]
* ] * ]
* ] * ]
* ] * ]
* ] * ]
* ] * ]
* ] * ]
* ] * ]
⚫ ==References==
* ]
⚫ {{reflist}}


{{Nucleotide sugars}} {{Nucleotide sugars}}
{{Fructose and galactose metabolic intermediates}} {{Fructose and galactose metabolic intermediates}}
{{Purinergics}}


] ]
] ]

]
]
]