| Revision as of 15:41, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444242459 of page Valencene for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 17:48, 3 March 2024 edit Smokefoot (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers74,495 edits ref and data |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 444241198 |
|
| verifiedrevid = 470627757 |
|
|ImageFile=valencene.png |
|
| ImageFile =Valencene.svg |
|
|ImageSize= |
|
| ImageSize = |
|
|IUPACName=((2R)-8,8,8a-trimethyl-2-prop-1-en-2-yl-1,2,3,4,6,7-hexahydronaphthalene |
|
|
|
| IUPACName = 4α,5α-Eremophila-1(10),11-diene |
| ⚫ |
|OtherNames= |
|
|
|
| SystematicName = (3''R'',4a''S'',5''R'')-4a,5-Dimethyl-3-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,7-octahydronaphthalene |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames = |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8031495 |
|
| ChemSpiderID = 8031495 |
|
| InChI = 1/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3/t12-,13-,15+/m1/s1 |
|
| InChI = 1/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3/t12-,13-,15+/m1/s1 |
| Line 15: |
Line 16: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = QEBNYNLSCGVZOH-NFAWXSAZSA-N |
|
| StdInChIKey = QEBNYNLSCGVZOH-NFAWXSAZSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=4630-07-3 |
|
| CASNo =4630-07-3 |
|
| PubChem = 9855795 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| PubChem = 9855795 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 96H21P91IG |
|
| UNII = 96H21P91IG |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
| Line 23: |
Line 25: |
|
| SMILES = C\12=C\CC(/1(C(\C(=C)C)CC2)C)C |
|
| SMILES = C\12=C\CC(/1(C(\C(=C)C)CC2)C)C |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>15</sub>H<sub>24</sub> |
|
| C=15|H=24 |
|
⚫ |
| Appearance =colorless oil |
|
| MolarMass=204.35 |
|
|
|
| Density = |
| ⚫ |
| Appearance= |
|
|
|
| MeltingPt = |
|
| Density= |
|
|
|
| BoilingPtC = 123 |
|
| MeltingPt= |
|
|
| BoilingPt=123 °C at 11 mmHg |
|
| BoilingPt_notes = at 11 mmHg |
|
| Solubility= |
|
| Solubility = organic solvents |
| ⚫ |
}} |
|
| ⚫ |
|Section3= {{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Valencene''' is a ] that is an aroma component of ] fruit and citrus-derived odorants. It is obtained inexpensively from Valencia ].<ref>{{cite journal |
|
|
| last =Furusawa |
|
|
| first =Mai |
|
|
| author2 =Toshihiro Hashimoto |author3=Yoshiaki Noma |author4=Yoshinori Asakawa |
|
|
| title =Highly Efficient Production of Nootkatone, the Grapefruit Aroma from Valencene, by Biotransformation |
|
|
| journal =Chem. Pharm. Bull. |
|
|
| volume =53 |
|
|
| issue =11 |
|
|
| pages =1513–1514 |
|
|
| date =November 2005 |
|
|
| doi =10.1248/cpb.53.1513 |
|
|
| pmid =16272746 | doi-access =free |
|
|
}}</ref> Valencene is ] from ] (FPP) by the ]. |
|
|
|
|
|
It is used as a precursor to ], the main contributor to the aroma and flavor of ].<ref>{{cite journal | author = M. M. Bomgardner | title = Fragrances 101. A Fortuitous Field of Flavors and Fragrances | journal = ] | volume = 90 | issue = 29 | date = July 16, 2012 | url = http://cen.acs.org/articles/90/i29/Fragrances-101.html}}</ref><ref>{{cite book |doi=10.1007/10_2014_279 |chapter=Nootkatone |title=Biotechnology of Isoprenoids |series=Advances in Biochemical Engineering/Biotechnology |date=2014 |last1=Leonhardt |first1=Robin-Hagen |last2=Berger |first2=Ralf G. |volume=148 |pages=391–404 |pmid=25326849 |isbn=978-3-319-20106-1 }}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Terpenes}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |