| Revision as of 13:15, 27 November 2010 editCitation bot (talk | contribs)Bots5,392,636 editsm Citations: added: last1, first1, last2, first2, last3, first3, title, journal, volume, issue, pages, year, doi, last4, first4, last5, first5, last6, first6, last7, first7, last8, first8, last9, first9. Rjwilmsi← Previous edit |
Latest revision as of 19:23, 6 September 2022 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Added UNII |
| (41 intermediate revisions by 26 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = (2S)-N-ethyl]-2-(4-fluoro-2-methylphenyl)-N-methylpiperazine-1-carboxamide |
|
|
|
| Watchedfields = changed |
|
| image = Vestipitant_structure.png |
|
|
|
| verifiedrevid = 399133414 |
|
| width = 220 |
|
|
⚫ |
| IUPAC_name = (2''S'')-''N''-{(1''R'')-1-ethyl}-2-(4-fluoro-2-methylphenyl)-''N''-methylpiperazine-1-carboxamide |
| ⚫ |
| CAS_number = 334476-64-1 |
|
|
|
| image = Vestipitant structure.svg |
| ⚫ |
| CAS_supplemental = |
|
|
|
| width = 225 |
| ⚫ |
| ATC_prefix = none |
|
|
|
|
| ⚫ |
| ATC_suffix = |
|
|
|
<!--Clinical data--> |
| ⚫ |
| PubChem = 9832383 |
|
|
|
| tradename = |
| ⚫ |
| DrugBank = |
|
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| ⚫ |
| C=23|H=21|F=10|N=3|O=1 |
|
|
⚫ |
| pregnancy_US = |
|
| molecular_weight = 545.416 g/mol |
|
|
⚫ |
| pregnancy_category = |
| ⚫ |
| smiles = FC(F)(F)c1cc(F)ccc1C2CNCCN2C(=O)N(C)C(C)c3cc(C(F)(F)F)cc(c3)C(F)(F)F |
|
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
| ⚫ |
| bioavailability = |
|
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
| ⚫ |
| protein_bound = |
|
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
| ⚫ |
| metabolism = |
|
|
⚫ |
| legal_US = |
|
| elimination_half-life = |
|
|
|
|
| ⚫ |
| excretion = |
|
|
|
<!--Pharmacokinetic data--> |
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
⚫ |
| bioavailability = |
| ⚫ |
| pregnancy_US = |
|
|
⚫ |
| protein_bound = |
| ⚫ |
| pregnancy_category= |
|
|
⚫ |
| metabolism = |
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
⚫ |
| excretion = |
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
|
<!--Identifiers--> |
| ⚫ |
| legal_US = |
|
|
|
| index2_label = Mesylate |
|
| routes_of_administration = |
|
|
|
| CAS_number2_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number2 = 334476-64-1 |
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII2 = OWR424W90Q |
|
|
| IUPHAR_ligand = 5757 |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number = 334476-46-9 |
|
⚫ |
| CAS_supplemental = |
|
⚫ |
| ATC_prefix = None |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 9832383 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = S052TOI9BI |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 522987 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 8008111 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = D06293 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=23 | H=21 | F=10 | N=3 | O=1 |
|
⚫ |
| smiles = FC(F)(F)c1cc(F)ccc1C2CNCCN2C(=O)N(C)C(C)c3cc(C(F)(F)F)cc(c3)C(F)(F)F |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C23H24F7N3O/c1-13-8-18(24)4-5-19(13)20-12-31-6-7-33(20)21(34)32(3)14(2)15-9-16(22(25,26)27)11-17(10-15)23(28,29)30/h4-5,8-11,14,20,31H,6-7,12H2,1-3H3/t14-,20-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = SBBYBXSFWOLDDG-JLTOFOAXSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Vestipitant''' is a drug developed by ] which acts as a selective ] for the ] ]. It is under development as a potential ] and ] drug,<ref>{{cite journal | last1 = Reddy | first1 = GK | last2 = Gralla | first2 = RJ | last3 = Hesketh | first3 = PJ | title = Novel neurokinin-1 antagonists as antiemetics for the treatment of chemotherapy-induced emesis | journal = Supportive cancer therapy | volume = 3 | issue = 3 | pages = 140–2 | year = 2006 | pmid = 18632487 | doi = 10.3816/SCT.2006.n.011 }}</ref><ref>{{cite journal | last1 = Brocco | first1 = M | last2 = Dekeyne | first2 = A | last3 = Mannoury La Cour | first3 = C | last4 = Touzard | first4 = M | last5 = Girardon | first5 = S | last6 = Veiga | first6 = S | last7 = De Nanteuil | first7 = G | last8 = Dejong | first8 = TR | last9 = Olivier | first9 = B | title = Cellular and behavioural profile of the novel, selective neurokinin1 receptor antagonist, vestipitant: a comparison to other agents | journal = European neuropsychopharmacology : the journal of the European College of Neuropsychopharmacology | volume = 18 | issue = 10 | pages = 729–50 | year = 2008 | pmid = 18657401 | doi = 10.1016/j.euroneuro.2008.06.002 }}</ref> and as a treatment for ].<ref>{{ClinicalTrialsGov|NCT00394056|Vestipitant Or Vestipitant/Paroxetine Combination In Subjects With Tinnitus And Hearing Loss}}</ref> |
|
'''Vestipitant''' (])<ref name="INN">{{cite web | title=International Nonproprietary Names for Pharmaceutical Substances (INN). Recommended International Nonproprietary Names: List 53 | url =https://www.who.int/medicines/publications/druginformation/innlists/RL53.pdf | publisher = World Health Organization | access-date = 17 November 2016}}</ref>{{rp|98}} is a drug developed by ] which acts as a selective ] for the ] ]. It is under development as a potential ] and ] drug,<ref>{{cite journal | vauthors = Reddy GK, Gralla RJ, Hesketh PJ | title = Novel neurokinin-1 antagonists as antiemetics for the treatment of chemotherapy-induced emesis | journal = Supportive Cancer Therapy | volume = 3 | issue = 3 | pages = 140–2 | date = April 2006 | pmid = 18632487 | doi = 10.3816/SCT.2006.n.011 }}</ref><ref>{{cite journal | vauthors = Brocco M, Dekeyne A, Mannoury la Cour C, Touzard M, Girardon S, Veiga S, de Nanteuil G, deJong TR, Olivier B, Millan MJ | display-authors = 6 | title = Cellular and behavioural profile of the novel, selective neurokinin1 receptor antagonist, vestipitant: a comparison to other agents | journal = European Neuropsychopharmacology | volume = 18 | issue = 10 | pages = 729–50 | date = October 2008 | pmid = 18657401 | doi = 10.1016/j.euroneuro.2008.06.002 | s2cid = 8258896 }}</ref> and as a treatment for ]<ref>{{ClinicalTrialsGov|NCT00394056|Vestipitant Or Vestipitant/Paroxetine Combination In Subjects With Tinnitus And Hearing Loss}}</ref> and ].<ref>{{cite journal | vauthors = Ratti E, Carpenter DJ, Zamuner S, Fernandes S, Squassante L, Danker-Hopfe H, Archer G, Robertson J, Alexander R, Trist DG, Merlo-Pich E | display-authors = 6 | title = Efficacy of vestipitant, a neurokinin-1 receptor antagonist, in primary insomnia | journal = Sleep | volume = 36 | issue = 12 | pages = 1823–30 | date = December 2013 | pmid = 24293756 | pmc = 3825431 | doi = 10.5665/sleep.3208 }}</ref> |
|
|
|
|
|
== See also == |
|
== See also == |
|
|
{{div col}} |
|
<div style="-moz-column-count:2; column-count:2; -webkit-column-count:2;"> |
|
|
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
| Line 36: |
Line 67: |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
{{div col end}} |
|
</div> |
|
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist|2}} |
|
{{Reflist|2}} |
|
|
|
|
|
{{Antiemetics and antinauseants}} |
|
{{Antiemetics}} |
|
|
{{Neurokinin receptor modulators}} |
|
{{Antidepressants}} |
|
|
{{Anxiolytics}} |
|
|
{{Neuropeptide agonists and antagonists}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{gastrointestinal-drug-stub}} |
|
{{gastrointestinal-drug-stub}} |