| Revision as of 16:03, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456639397 of page Vitexin for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 21:16, 7 September 2024 edit Josve05a (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers, Pending changes reviewers, Rollbackers153,282 editsm →top: removing unnecessary archive to dead link |
| Line 1: |
Line 1: |
|
|
{{cs1 config|name-list-style=vanc}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 441541138 |
|
| verifiedrevid = 470631187 |
|
|ImageFile=Vitexin.png |
|
| ImageFile =Vitexin.svg |
|
|ImageSize=200px |
|
| ImageSize = |
|
|
| IUPACName = 8-(β-{{small|D}}-Glucopyranosyl)-4′,5,7-trihydroxyflavone |
|
|IUPACName= |
|
|
|
| SystematicName = 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8--4''H''-1-benzopyran-4-one |
|
|OtherNames=]-8-C-] |
|
| OtherNames =]-8-''C''-] |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4444098 |
|
| ChemSpiderID = 4444098 |
|
| InChI = 1/C21H20O10/c22-7-14-17(27)18(28)19(29)21(31-14)16-11(25)5-10(24)15-12(26)6-13(30-20(15)16)8-1-3-9(23)4-2-8/h1-6,14,17-19,21-25,27-29H,7H2/t14-,17-,18+,19-,21+/m1/s1 |
|
| InChI = 1/C21H20O10/c22-7-14-17(27)18(28)19(29)21(31-14)16-11(25)5-10(24)15-12(26)6-13(30-20(15)16)8-1-3-9(23)4-2-8/h1-6,14,17-19,21-25,27-29H,7H2/t14-,17-,18+,19-,21+/m1/s1 |
| Line 17: |
Line 18: |
|
| StdInChIKey = SGEWCQFRYRRZDC-VPRICQMDSA-N |
|
| StdInChIKey = SGEWCQFRYRRZDC-VPRICQMDSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=3681-93-4 |
|
| CASNo =3681-93-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem=5280441 |
|
|
|
| UNII = 9VP70K75OK |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C01460 |
|
⚫ |
| PubChem =5280441 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 487417 |
|
| ChEMBL = 487417 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 16954 |
|
| ChEBI = 16954 |
|
| SMILES = O=C2\C=C(/Oc1c(c(O)cc(O)c12)3O((O)(O)3O)CO)c4ccc(O)cc4 |
|
| SMILES = O=C2\C=C(/Oc1c(c(O)cc(O)c12)3O((O)(O)3O)CO)c4ccc(O)cc4 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>21</sub>H<sub>20</sub>O<sub>10</sub> |
|
| Formula =C<sub>21</sub>H<sub>20</sub>O<sub>10</sub> |
|
| MolarMass= 432.38 g/mol |
|
| MolarMass = 432.38 g/mol |
|
⚫ |
| Appearance = Light yellow powder |
|
| ExactMass = 432.105647 |
|
|
|
| Density = |
| ⚫ |
| Appearance = Light yellow powder |
|
|
|
| MeltingPtC = 203 to 204 |
|
| Density= |
|
|
|
| MeltingPt_notes = |
|
| MeltingPt = 203–204 °C |
|
|
| BoilingPt= |
|
| BoilingPt = |
|
| Solubility= |
|
| Solubility = |
| ⚫ |
}} |
|
| ⚫ |
|Section3= {{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Vitexin''' is an ] ] ], a chemical compound found in the ], '']'' (chaste tree or chasteberry), in the '']'' bamboo leaves,<ref>{{cite journal | last1 = Zhang | first1 = Y | journal = Food Chemistry | last2 = Jiao | first2 = J | last3 = Liu | first3 = C | last4 = Wu | first4 = X | last5 = Zhang | first5 = Y | title = Isolation and purification of four flavone C-glycosides from antioxidant of bamboo leaves by macroporous resin column chromatography and preparative high-performance liquid chromatography | year = 2007|doi = 10.1016/j.foodchem.2007.09.037 }}</ref> in the ] (Pennisetum millet),<ref>{{Cite journal | url = http://www.aaccnet.org/cerealchemistry/backissues/1991/68_180.pdf | title = Effect of Processing on Flavonoids in Millet (Pennisetum americanum) Flour | author = J.O. AKINGBALA | year = 1991 | journal = Cereal Chem. | volume = 68 | issue = 2 | pages = 180–183 | access-date = 2009-08-21 | archive-url = https://web.archive.org/web/20090514213426/http://www.aaccnet.org/cerealchemistry/backissues/1991/68_180.pdf | archive-date = 2009-05-14 | url-status = dead }}</ref> and in ].<ref>{{Cite book|title=Gustav Hegi. Illustrierte Flora von Mitteleuropa IV(2B). Spermatophyta: Angiospermae: Dicotyledones 2(3). Rosaceae 2|last=Scholz|first=Hildemar|publisher=Blackwell Wissenschafts-Verlag|year=1995|isbn=978-3-8263-2533-5|edition=2nd|location=Berlin|pages=431}}</ref> |
|
|
|
|
|
== Metabolism == |
|
|
] of millet flavones : Vitexin inhibits ] thus contributing to ].<ref>{{cite journal | last1 = Gaitan | first1 = E | title = Goitrogens in food and water. | journal = Annual Review of Nutrition | volume = 10 | pages = 21–39 | year = 1990 | pmid = 1696490 | doi = 10.1146/annurev.nu.10.070190.000321}}</ref><ref>{{cite journal | vauthors = Birzer DM, Klopfenstein CF, Leipold HW| year = 1987 | title = Goitre causing compounds found in pearl millet | journal = Nutr. Rep. Int. | volume = 36 | pages = 131–141|issn = 0029-6635}}</ref> |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== See also == |
|
|
* ] (or homovitexin, saponaretin) is the apigenin-6-''C''-glucoside. |
|
|
* ], the 3'-OH derivative |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
== External links == |
|
|
* |
|
|
|
|
|
{{flavone}} |
|
|
|
|
|
] |
|
|
] |