| Revision as of 16:08, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457086247 of page Vorozole for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey', 'CAS_number'). |
Latest revision as of 17:42, 7 September 2024 edit JWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Chloroarenes; added Category:4-Chlorophenyl compounds using HotCat |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{cs1 config|name-list-style=vanc}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 409110490 |
|
| verifiedrevid = 470631940 |
|
| IUPAC_name = 6--<br>-1-methylbenzotriazole |
|
| IUPAC_name = 6--1-methylbenzotriazole |
|
| image = Vorozole.svg |
|
| image = Vorozole.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 17: |
Line 18: |
|
| metabolism = Hepatic |
|
| metabolism = Hepatic |
|
| elimination_half-life = 8 hours |
|
| elimination_half-life = 8 hours |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 118949-22-7 --> |
|
| CAS_number = 129731-10-8 |
|
| ATC_prefix = L02 |
|
| ATC_prefix = L02 |
|
| ATC_suffix = BG05 |
|
| ATC_suffix = BG05 |
| Line 28: |
Line 29: |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 5293402 |
|
| ChemSpiderID = 5293402 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 1E2S9YXV2A |
|
| UNII = 1E2S9YXV2A |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D03786 |
|
| KEGG = D03786 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 224060 |
|
| ChEMBL = 224060 |
|
|
| synonyms = R-76713; Rizivor |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=16 | H=13 | Cl=1 | N=6 |
|
| C=16 | H=13 | Cl=1 | N=6 |
|
⚫ |
| SMILES = Clc1ccc(cc1)(c2ccc3nnn(c3c2)C)n4ncnc4 |
|
| molecular_weight = 324.768 g/mol |
|
| ⚫ |
| smiles = Clc1ccc(cc1)(c2ccc3nnn(c3c2)C)n4ncnc4 |
|
|
| InChI = 1/C16H13ClN6/c1-22-15-8-12(4-7-14(15)20-21-22)16(23-10-18-9-19-23)11-2-5-13(17)6-3-11/h2-10,16H,1H3/t16-/m0/s1 |
|
|
| InChIKey = XLMPPFTZALNBFS-INIZCTEOBI |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C16H13ClN6/c1-22-15-8-12(4-7-14(15)20-21-22)16(23-10-18-9-19-23)11-2-5-13(17)6-3-11/h2-10,16H,1H3/t16-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = XLMPPFTZALNBFS-INIZCTEOSA-N |
|
|
}} |
|
}} |
|
|
|
|
|
'''Vorozole''' (developmental code name '''R-76713'''; former tentative brand name '''Rizivor''') is a ] based ] of the ] enzyme. It underwent clinical testing for evaluation for use as an ] agent; however it was withdrawn from testing when no difference was detected in the duration of median survival as compared to the progestational agent ] and research instead focused on the other third generation ] ], ] and ].<ref name="pmid9797019">{{cite journal | vauthors = Goss PE | title = Pre-clinical and clinical review of vorozole, a new third generation aromatase inhibitor | journal = Breast Cancer Research and Treatment | volume = 49 | pages = S59-65; discussion S73-7 | year = 1998 | pmid = 9797019 | doi = 10.1023/a:1006052923468 | url = http://www.kluweronline.com/art.pdf?issn=0167-6806&volume=49%20Suppl%201&page=S59 | series = 49 | issue = Suppl 1 | s2cid = 28231447 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{Antineoplastic-drug-stub}} |