| Revision as of 21:32, 1 September 2011 editBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot← Previous edit |
Latest revision as of 09:05, 9 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits added Category:2-Chlorophenyl compounds using HotCat |
| (22 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443807220 |
|
| verifiedrevid = 447927404 |
|
| IUPAC_name = 8-chloro- 6-(2-chlorophenyl)- 4''H''- pyrido triazolo diazepine |
|
| IUPAC_name = 8-Chloro-6-(2-chlorophenyl)-4''H''-pyridotriazolodiazepine |
|
| image = Zapizolam.svg |
|
| image = Zapizolam.svg |
|
| width = 150 |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 16: |
Line 17: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 64098-32-4 |
|
| CAS_number = 64098-32-4 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
| Line 27: |
Line 29: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=15 | H=9 | Cl=2 | N=5 |
|
| C=15 | H=9 | Cl=2 | N=5 |
|
| molecular_weight = 330.171 |
|
|
| smiles = Clc4ccccc4C/3=N/Cc1nncn1c2c\3nc(Cl)cc2 |
|
| smiles = Clc4ccccc4C/3=N/Cc1nncn1c2c\3nc(Cl)cc2 |
|
| InChI = 1/C15H9Cl2N5/c16-10-4-2-1-3-9(10)14-15-11(5-6-12(17)20-15)22-8-19-21-13(22)7-18-14/h1-6,8H,7H2 |
|
|
| InChIKey = FOWABKOXWTZAKY-UHFFFAOYAA |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C15H9Cl2N5/c16-10-4-2-1-3-9(10)14-15-11(5-6-12(17)20-15)22-8-19-21-13(22)7-18-14/h1-6,8H,7H2 |
|
| StdInChI = 1S/C15H9Cl2N5/c16-10-4-2-1-3-9(10)14-15-11(5-6-12(17)20-15)22-8-19-21-13(22)7-18-14/h1-6,8H,7H2 |
| Line 37: |
Line 36: |
|
}} |
|
}} |
|
|
|
|
|
|
'''Zapizolam'''<ref>{{cite patent | country = DE | number = 2649116 | title = Neue 6-aryl-s-triazolo-(4,3-a)- pyrido-(2,3-f)-1,4-diazepine | inventor = Von Bebenburg W, Schulmeyer N, Jakovlev V | assign1 = Evonik Operations GmbH | pubdate = 18 May 1977 | status = Withdrawn }}</ref> is a pyridodiazepine drug, which is a ] analog of ] group. It has ] and ] effects similar to those produced by benzodiazepine derivatives, and has been sold illicitly as a ].<ref name="pmid30802466">{{cite journal | vauthors = Zawilska JB, Wojcieszak J | title = An expanding world of new psychoactive substances-designer benzodiazepines | journal = Neurotoxicology | volume = 73 | pages = 8–16 | date = July 2019 | pmid = 30802466 | doi = 10.1016/j.neuro.2019.02.015 | s2cid = 73461430 }}</ref> |
|
'''Zapizolam''' is a pyridodiazepine drug, which is a ] analog, specifically the pyridodiazepine analog of triazolam.<ref></ref> Presumably it has ] and ] effects similar to those produced by benzodiazepine derivatives.<!-- --> |
|
|
|
|
|
|
==References== |
|
==References== |
| Line 43: |
Line 42: |
|
|
|
|
|
{{Benzodiazepines}} |
|
{{Benzodiazepines}} |
|
|
{{GABAAR PAMs}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{sedative-stub}} |