Angustific acid - Misplaced Pages

Angustific acids A and B
Names

IUPAC names A:(2Z)-6-octadec-7-en-7-yl]-2-methyl-2,6-heptadienoic acid B: (2Z,6S)-6-cyclopropanaphthalen-1-yl]-6-hydroxy-2-methyl-2-heptenoic acid
Identifiers
3D model (JSmol)	A: Interactive image B: Interactive image
ChEMBL	A: ChEMBL1669428 B: ChEMBL1669429
ChemSpider	A: 26389056 B: 26387137
PubChem CID	A: 53325465 B: 51003481
InChI A: InChI=1S/C30H40O4/c1-18(2)22-16-23-25-28(6)12-10-21(19(3)8-7-9-20(4)26(32)33)27(28,5)14-15-30(25)17-29(22,30)13-11-24(31)34-23/h9-10,22-23,25H,1,3,7-8,11-17H2,2,4-6H3,(H,32,33)/b20-9-/t22-,23-,25+,27-,28+,29-,30+/m1/s1Key: OEBCOPKBNAGZEV-PNVFSJBDSA-N B: InChI=1S/C30H44O7/c1-17(2)19-14-20(31)24-28(6)22(32)15-21(27(5,37)10-7-8-18(3)25(35)36)26(28,4)12-13-30(24)16-29(19,30)11-9-23(33)34/h8,15,19-20,22,24,31-32,37H,1,7,9-14,16H2,2-6H3,(H,33,34)(H,35,36)/b18-8-/t19-,20-,22-,24-,26+,27-,28-,29+,30-/m0/s1Key: MHUCDSJUECUYSY-OTEBZQEVSA-N
SMILES A: CC(=C)1C234(CC=C(4(CC351(C5)CCC(=O)O2)C)C(=C)CC/C=C(/C)\C(=O)O)C B: CC(=C)1C(23((C=C(3(CC241(C4)CCC(=O)O)C)(C)(CC/C=C(/C)\C(=O)O)O)O)C)O
Properties
Chemical formula	A: C₃₀H₄₀O₄ B:C₃₀H₄₄O₇
Molar mass	A: 464.64 g/mol B: 516.67 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Infobox references

Chemical compound

Angustific acid A and angustific acid B are antiviral compounds isolated from Kadsura angustifolia. They are triterpenoids.

References

Sun, R.; Song, HC.; Wang, CR.; Shen, KZ.; Xu, YB.; Gao, YX.; Chen, YG.; Dong, JY. (Feb 2011). "Compounds from Kadsura angustifolia with anti-HIV activity". Bioorg Med Chem Lett. 21 (3): 961–5. doi:10.1016/j.bmcl.2010.12.055. PMID 21232955.
Xia, Yong-Gang; Yang, Bing-You; Kuang, Hai-Xue (April 2015). "Schisandraceae triterpenoids: a review". Phytochemistry Reviews. 14 (2): 155–187. Bibcode:2015PChRv..14..155X. doi:10.1007/s11101-014-9343-7. ISSN 1568-7767. S2CID 6920531.

This article about a heterocyclic compound is a stub. You can help Misplaced Pages by expanding it.