| Revision as of 11:33, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 461404996 of page Plumbagin for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 20:42, 26 September 2024 edit Citation bot (talk | contribs)Bots5,389,927 edits Add: url, doi, bibcode. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | #UCB_webform 1677/3309 |
| Line 1: |
Line 1: |
|
|
{{for|the mineral known as plombagine|Plumbago (mineral)}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{Chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 408417931 |
|
| verifiedrevid = 461751697 |
|
| Name = Plumbagin |
|
| Name = Plumbagin |
|
| ImageFile = Plumbagin.PNG |
|
| ImageFile = Plumbagin.PNG |
|
| ImageSize = 180 |
|
| ImageSize = 180 |
|
| ImageName = Skeletal formula of plumbagin |
|
| ImageName = Skeletal formula of plumbagin |
|
| ImageFile1 = Plumbagin-3D-balls.png |
|
| ImageFile1 = Plumbagin-3D-balls.png |
|
| ImageSize1 = 190 |
|
| ImageSize1 = 190 |
|
| ImageName1 = Ball-and-stick model of plumbagin |
|
| ImageName1 = Ball-and-stick model of plumbagin |
|
| IUPACName = 5-hydroxy-2-methyl-naphthalene-1,4-dione |
|
| PIN = 5-Hydroxy-2-methylnaphthalene-1,4-dione |
|
| OtherNames = |
|
| OtherNames = |
|
|
| SystematicName = |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| IUPHAR_ligand = 7003 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9790 |
|
| ChemSpiderID = 9790 |
|
| PubChem = 10205 |
|
| PubChem = 10205 |
| Line 26: |
Line 28: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VCMMXZQDRFWYSE-UHFFFAOYSA-N |
|
| StdInChIKey = VCMMXZQDRFWYSE-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 481-42-5 --> |
|
| CASNo = 481-42-5 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = YAS4TBQ4OQ |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 8273 |
|
| ChEBI = 8273 |
|
| SMILES = O=C\2c1c(O)cccc1C(=O)/C(=C/2)C |
|
| SMILES = Oc1c2C(=O)cc(C)C(=O)c2ccc1 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = C<sub>11</sub>H<sub>8</sub>O<sub>3</sub> |
|
| Formula = C<sub>11</sub>H<sub>8</sub>O<sub>3</sub> |
|
| MolarMass = 188.17942 g/mol |
|
| MolarMass = 188.17942 g/mol |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
|
| Section3 = |
|
|
| Section4 = |
|
|
| Section5 = |
|
|
| Section6 = |
|
}} |
|
}} |
|
|
|
|
|
'''Plumbagin''' or '''5-hydroxy-2-methyl-1,4-naphthoquinone''' is an ] with the ] {{chem|C|11|H|8|O|3}}. It is regarded as a ]<ref name=walnut /> and it is ]<ref>{{Cite journal | journal = Toxicology in Vitro | volume = 23 | issue = 2 | year = 2009 | pages = 266–271 | title = Genotoxicity of plumbagin and its effects on catechol and NQNO-induced DNA damage in mouse lymphoma cells |author1=Jemal Demma |author2=Karl Hallberg |author3=Björn Hellman | doi = 10.1016/j.tiv.2008.12.007| pmid = 19124069 | bibcode = 2009ToxVi..23..266D }}</ref> and ].<ref>{{Cite journal | journal = J Bacteriol | year = 1985 | volume = 164 | issue = 3 | pages = 1309–1316 | pmc = 219331 | title = Toxicity and mutagenicity of plumbagin and the induction of a possible new DNA repair pathway in Escherichia coli |author1=S B Farr |author2=D O Natvig |author3=T Kogoma | doi = 10.1128/JB.164.3.1309-1316.1985 |name-list-style=amp | pmid=2933393}}</ref> |
|
|
|
|
|
Plumbagin is a yellow ],<ref name=walnut>. Drugs.com.</ref> formally derived from ]. |
|
|
|
|
|
It is named after the plant genus '']'', from which it was originally isolated.<ref>{{ cite journal |author1=van der Vijver |author2=L. M. | title = Distribution of Plumbagin in the Plumbaginaceae | journal = Phytochemistry | year = 1972 | volume = 11 | issue = 11 | pages = 3247–3248 | doi = 10.1016/S0031-9422(00)86380-3 |bibcode=1972PChem..11.3247V }}</ref> |
|
|
It is also commonly found in the ] genera '']'' and '']''.<ref>{{ cite journal |author1=Wang, W. |author2=Luo, X. |author3=Li, H. | title = Terahertz and Infrared Spectra of Plumbagin, Juglone, and Menadione | journal = ] | year = 2010 | volume = 39 | issue = 3 | pages = 82–88 |doi=10.55360/cpn393.ww544 |url=https://www.biodiversitylibrary.org/part/265979 }}</ref><ref name=Rischer>{{ cite journal |author1=Rischer, H. |author2=Hamm, A. |author3=Bringmann, G. | title = ''Nepenthes insignis'' Uses a C<sub>2</sub>-Portion of the Carbon Skeleton of L-Alanine Acquired via its Carnivorous Organs, to Build up the Allelochemical Plumbagin | journal = Phytochemistry | year = 2002 | volume = 59 | issue = 6 | pages = 603–609 | doi = 10.1016/S0031-9422(02)00003-1 |pmid=11867092 |bibcode=2002PChem..59..603R }}</ref> It is also a component of the ] drupe. |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |