| Revision as of 11:57, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444072573 of page Pterulone for the Chem/Drugbox validation project (updated: 'ChEMBL', 'StdInChI'). |
Latest revision as of 16:09, 18 August 2022 edit Fswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Added UNII |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| verifiedrevid = 464376286 |
|
| ImageFile = Pterulone.png |
|
| ImageFile = Pterulone.svg |
|
| ImageSize = |
|
| ImageSize = |
|
| IUPACName = 1-ethanone |
|
| PIN = 1-ethan-1-one |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| InChI = 1S/C13H11ClO2/c1-9(15)11-4-5-13-12(6-11)3-2-10(7-14)8-16-13/h2-7H,8H2,1H3/b10-7- |
|
| InChI = 1S/C13H11ClO2/c1-9(15)11-4-5-13-12(6-11)3-2-10(7-14)8-16-13/h2-7H,8H2,1H3/b10-7- |
|
| InChIKey1 = QEWSARCWWQPUSM-YFHOEESVSA-N |
|
| InChIKey1 = QEWSARCWWQPUSM-YFHOEESVSA-N |
|
| InChI1 = 1S/C13H11ClO2/c1-9(15)11-4-5-13-12(6-11)3-2-10(7-14)8-16-13/h2-7H,8H2,1H3/b10-7- |
|
| InChI1 = 1S/C13H11ClO2/c1-9(15)11-4-5-13-12(6-11)3-2-10(7-14)8-16-13/h2-7H,8H2,1H3/b10-7- |
|
|
| CASNo_Ref = {{cascite|changed|ChemSpider}} |
|
| CASNo = |
|
|
| ChEMBL = 450490 |
|
| CASNo = 369376-61-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = A69767WW45 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 450490 |
|
| PubChem = 11424846 |
|
| PubChem = 11424846 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9599722 |
|
| ChemSpiderID = 9599722 |
| ⚫ |
| StdInChIKey = QEWSARCWWQPUSM-YFHOEESVSA-N |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = QEWSARCWWQPUSM-YFHOEESVSA-N |
|
| SMILES = O=C(c2ccc1OCC(/C=C\c1c2)=Cl)C |
|
| SMILES = O=C(c2ccc1OCC(/C=C\c1c2)=Cl)C |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C13H11ClO2/c1-9(15)11-4-5-13-12(6-11)3-2-10(7-14)8-16-13/h2-7H,8H2,1H3/b10-7- |
|
| StdInChI = 1S/C13H11ClO2/c1-9(15)11-4-5-13-12(6-11)3-2-10(7-14)8-16-13/h2-7H,8H2,1H3/b10-7- |
|
⚫ |
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
⚫ |
| Formula = C<sub>13</sub>H<sub>11</sub>ClO<sub>2</sub> |
|
⚫ |
| MolarMass = 234.678 |
|
⚫ |
| Appearance = |
|
⚫ |
| Density = |
|
⚫ |
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
⚫ |
| Solubility = |
|
⚫ |
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards = |
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = |
|
|
}} |
|
}} |
|
}} |
|
|
|
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
'''Pterulone''' is a ] metabolite. It was initially isolated from the ] and ]s of ] in the genus '']''. The compound inhibits eukaryotic ] by targeting the mitochondrial ].<ref name=Engler1997/> |
| ⚫ |
| Formula = C<sub>13</sub>H<sub>11</sub>ClO<sub>2</sub> |
|
|
|
|
| ⚫ |
| MolarMass = 234.678 |
|
|
|
== References == |
| ⚫ |
| Appearance = |
|
|
|
{{Reflist|refs = |
| ⚫ |
| Density = |
|
|
|
|
| ⚫ |
| MeltingPt = |
|
|
|
<ref name=Engler1997>{{cite journal |vauthors=Engler M, Anke T, Sterner O, Brandt U |title=Pterulinic acid and pterulone, two novel inhibitors of NADH:ubiquinone oxidoreductase (complex I) produced by a ''Pterula'' species. I. Production, isolation and biological activities |journal=Journal of Antibiotics |volume=50 |issue=4 |pages=325–9 |year=1997 |pmid=9186558 |doi=10.7164/antibiotics.50.325|doi-access=free }}</ref> |
| ⚫ |
| BoilingPt = |
|
|
|
|
| ⚫ |
| Solubility = |
|
| ⚫ |
}} |
|
| ⚫ |
| Section3 = {{Chembox Hazards |
|
| ⚫ |
| MainHazards = |
|
| ⚫ |
| FlashPt = |
|
|
| Autoignition = |
|
| ⚫ |
}} |
|
|
}} |
|
}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{Organohalide-stub}} |
|
|
{{Heterocyclic-stub}} |