| Revision as of 12:24, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 469413133 of page Terizidone for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 00:49, 14 May 2023 edit Entranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,185 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 447906096 |
|
|
|
| Watchedfields = changed |
|
| IUPAC_name = 4,4'-{1,4-phenylenebis}diisoxazolidin-3-one |
|
|
⚫ |
| verifiedrevid = 470602455 |
| ⚫ |
| image = terizidone.png |
|
|
|
| IUPAC_name = 4,4'-<nowiki/>{1,4-Phenylenebis}bis(1,2-oxazolidin-3-one) |
|
⚫ |
| image = Terizidone.svg |
|
|
| width = 275 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|terizidone}} |
|
| Drugs.com = {{drugs.com|international|terizidone}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = C |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 25683-71-0 --> |
|
| CAS_number = 25683-71-0 |
|
| ATC_prefix = J04 |
|
| ATC_prefix = J04 |
|
| ATC_suffix = AK03 |
|
| ATC_suffix = AK03 |
|
| PubChem = 65720 |
|
| PubChem = 65720 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 59144 |
|
| ChemSpiderID = 59144 |
| Line 41: |
Line 44: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=14 | H=14 | N=4 | O=4 |
|
| C=14 | H=14 | N=4 | O=4 |
|
| molecular_weight = 302.286 g/mol |
|
|
| smiles = O=C3NOCC3/N=C/c2ccc(/C=N/C1C(=O)NOC1)cc2 |
|
| smiles = O=C3NOCC3/N=C/c2ccc(/C=N/C1C(=O)NOC1)cc2 |
|
| InChI = 1/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+ |
|
|
| InChIKey = ODKYYBOHSVLGNU-IAGONARPBB |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+ |
|
| StdInChI = 1S/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+ |
| Line 52: |
Line 52: |
|
| synonyms = <small>4-phenyl}methylidene)amino]-1,2-oxazolidin-3-one</small> |
|
| synonyms = <small>4-phenyl}methylidene)amino]-1,2-oxazolidin-3-one</small> |
|
}} |
|
}} |
|
|
|
|
|
'''Terizidone''' is a drug used in the treatment of ].<ref>{{cite journal | vauthors = Galietti F, Giorgis GE, Oliaro A, Boaro D, Ardizzi A, Barberis S, Massaglia GM | title = | journal = Minerva Medica | volume = 82 | issue = 7–8 | pages = 477–81 | year = 1991 | pmid = 1922892 }}</ref> Terizidone is mainly used in ] (MDR-TB) in conjunction with other second-line drugs. It is a derivate of ] and it is bacteriostatic.<ref>{{Cite book|title = South African Medicines Formulary|last = Rossiter|first = Dawn | name-list-style = vanc |publisher = Health and Medical Publishing Group of the South African Medical Association|year = 2012|isbn = 978-1-875098-28-6|location = Cape Town, South Africa|pages = 323–325}}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Antimycobacterials}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{antiinfective-drug-stub}} |