Cyphostemmin B - Misplaced Pages

Cyphostemmin B
Names

Other names Quadrangularin A
Identifiers
CAS Number	220328-16-5
3D model (JSmol)	Interactive image
ChEBI	CHEBI:76192
ChEMBL	ChEMBL2335820
ChemSpider	4476724
PubChem CID	5318096
InChI InChI=1S/C28H22O6/c29-18-5-1-15(2-6-18)9-23-24-13-22(33)14-25(34)28(24)27(16-3-7-19(30)8-4-16)26(23)17-10-20(31)12-21(32)11-17/h1-14,26-27,29-34H/b23-9-/t26-,27+/m1/s1Key: BIQMSWPBPAKGSE-PBSLAQMISA-N
SMILES c1cc(ccc1/C=C\2/c3cc(cc(c3(2c4cc(cc(c4)O)O)c5ccc(cc5)O)O)O)O
Properties
Chemical formula	C₂₈H₂₂O₆
Molar mass	454.478 g·mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Infobox references

Chemical compound

Cyphostemmin B is an oligostilbene found in Cyphostemma crotalarioides (Vitaceae). It is a resveratrol dimer.

References

"Cyphostemmin B | Chemical Substance Information | J-GLOBAL". Jglobal.JST.go.jp.
Ducrot, Paul-Henri; Kollmann, Albert; Bala, Adil E.; Majira, Amel; Kerhoas, Lucien; Delorme, Robert; Einhorn, Jacques (1998). "Cyphostemmins A-B, two new antifungal oligostilbenes from Cyphostemma crotalarioides (Vitaceae)". Tetrahedron Letters. 39 (52): 9655–9658. doi:10.1016/S0040-4039(98)02207-2.

Dimers

Trimers

Tetramers:

Higher polymers
(five units or more)

Oligomeric forms
of resveratrol

Dimers	Amurensin A and H Ampelopsin A B D and F Balanocarpol Cyphostemmin A and B δ-viniferin ε-viniferin Gnetin A and C Leachinol F Malibatol A Pallidol Parthenocissin A Quadrangularin A Restrytisol A, B and C Vitisinol D
Trimers	α-viniferin Ampelopsin C Amurensin C, D and G Hopeanolin Malaysianol A Miyabenol C Resviniferin A and B trans-diptoindonesin B
Tetramers	Ampelopsin H Amurensin K Caraphenol B Carasinol B Flexuosol A Hopeaphenol Kobophenol A Miyabenol A Vaticanol B and C Vaticaphenol A Vitisin A B and C β-viniferin (cyclic resveratrol tetramer)
Pentamers	Amurensin E and F
Hexamers	Chunganenol
Higher polymers	γ-viniferin Valeriaphenol A

Glycosides or conjugates

This article about an aromatic compound is a stub. You can help Misplaced Pages by expanding it.