Flexuosol A - Misplaced Pages

Flexuosol A
Names

Preferred IUPAC name 5--2,3,5,6-tetrahydro(benzodifuran)-3-yl}-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-yl]benzene-1,3-diol
Identifiers
CAS Number	205440-11-5
3D model (JSmol)	Interactive image
PubChem CID	71308201
UNII	8256ST4BZK
CompTox Dashboard (EPA)	DTXSID30745437
InChI InChI=1S/C56H42O11/c57-35-13-4-29(5-14-35)6-21-44-51-46(66-55(31-9-17-37(59)18-10-31)49(51)34-24-41(63)27-42(64)25-34)28-47-52(44)53(56(67-47)32-11-19-38(60)20-12-32)43-2-1-3-45-50(43)48(33-22-39(61)26-40(62)23-33)54(65-45)30-7-15-36(58)16-8-30/h1-28,48-49,53-64H/b21-6+/t48-,49-,53+,54+,55+,56-/m1/s1Key: AZTITUGYPXKUCV-CGOOCLRTSA-N
SMILES OC1=CC(2(C3=CC=C(O)C=C3)OC4=CC5=C((C6=CC=CC7=C6(C8=CC(O)=CC(O)=C8)(C9=CC=C(O)C=C9)O7)()(C%10=CC=C(O)C=C%10)O5)C(/C=C/C%11=CC=C(O)C=C%11)=C42)=CC(O)=C1
Properties
Chemical formula	C₅₆H₄₂O₁₂
Molar mass	906.940 g·mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Infobox references

Chemical compound

Flexuosol A is a resveratrol tetramer found in Vitis flexuosa.

References

Li, Wen-wu; Li, Bo-Gang; Chen, Yao-zu (1998). "Flexuosol A, a New Tetrastilbene fromVitis flexuosa". Journal of Natural Products. 61 (5): 646–7. doi:10.1021/np970457v. PMID 9599267.

Dimers

Trimers

Tetramers:

Higher polymers
(five units or more)

Oligomeric forms
of resveratrol

Dimers	Amurensin A and H Ampelopsin A B D and F Balanocarpol Cyphostemmin A and B δ-viniferin ε-viniferin Gnetin A and C Leachinol F Malibatol A Pallidol Parthenocissin A Quadrangularin A Restrytisol A, B and C Vitisinol D
Trimers	α-viniferin Ampelopsin C Amurensin C, D and G Hopeanolin Malaysianol A Miyabenol C Resviniferin A and B trans-diptoindonesin B
Tetramers	Ampelopsin H Amurensin K Caraphenol B Carasinol B Flexuosol A Hopeaphenol Kobophenol A Miyabenol A Vaticanol B and C Vaticaphenol A Vitisin A B and C β-viniferin (cyclic resveratrol tetramer)
Pentamers	Amurensin E and F
Hexamers	Chunganenol
Higher polymers	γ-viniferin Valeriaphenol A

Glycosides or conjugates

This article about an aromatic compound is a stub. You can help Misplaced Pages by expanding it.