trans-Diptoindonesin B - Misplaced Pages

*trans*-Diptoindonesin B
Names

Preferred IUPAC name 5-{(2S,2′S,3S,3′S)-6--6′-hydroxy-2,2′-bis(4-hydroxyphenyl)-2,2′,3,3′-tetrahydro-3′-yl}benzene-1,3-diol
Identifiers
CAS Number	610757-17-0
3D model (JSmol)	Interactive image
ChEBI	CHEBI:76196
ChemSpider	26233611
PubChem CID	641676
UNII	YP28HR5FRG
CompTox Dashboard (EPA)	DTXSID90348943
InChI InChI=1S/C42H32O9/c43-27-8-4-24(5-9-27)41-38(26-16-31(47)19-32(48)17-26)40-35(20-33(49)21-37(40)51-41)39-34-15-22(1-2-23-13-29(45)18-30(46)14-23)3-12-36(34)50-42(39)25-6-10-28(44)11-7-25/h1-21,38-39,41-49H/b2-1+/t38-,39+,41+,42+/m0/s1Key: BDJSWDYSJPVUJA-DVYDPXLZSA-N
SMILES OC1=CC(/C=C/C2=CC=C(O(C3=CC=C(O)C=C3)4C5=CC(O)=CC6=C5(C7=CC(O)=CC(O)=C7)(C8=CC=C(O)C=C8)O6)C4=C2)=CC(O)=C1
Properties
Chemical formula	C₄₂H₃₂O₉
Molar mass	680.709 g·mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references

Chemical compound

trans-Diptoindonesin B is an oligomeric stilbenoid.

References

Syah, YM; Aminah, NS; Hakim, EH; Aimi, N; Kitajima, M; Takayama, H; Achmad, SA (2003). "Two oligostilbenes, cis- and trans-diptoindonesin B, from Dryobalanops oblongifolia". Phytochemistry. 63 (8): 913–7. Bibcode:2003PChem..63..913S. doi:10.1016/S0031-9422(03)00274-7. PMID 12895539.

Dimers

Trimers

Tetramers:

Higher polymers
(five units or more)

Oligomeric forms
of resveratrol

Dimers	Amurensin A and H Ampelopsin A B D and F Balanocarpol Cyphostemmin A and B δ-viniferin ε-viniferin Gnetin A and C Leachinol F Malibatol A Pallidol Parthenocissin A Quadrangularin A Restrytisol A, B and C Vitisinol D
Trimers	α-viniferin Ampelopsin C Amurensin C, D and G Hopeanolin Malaysianol A Miyabenol C Resviniferin A and B trans-diptoindonesin B
Tetramers	Ampelopsin H Amurensin K Caraphenol B Carasinol B Flexuosol A Hopeaphenol Kobophenol A Miyabenol A Vaticanol B and C Vaticaphenol A Vitisin A B and C β-viniferin (cyclic resveratrol tetramer)
Pentamers	Amurensin E and F
Hexamers	Chunganenol
Higher polymers	γ-viniferin Valeriaphenol A

Glycosides or conjugates

This article about an aromatic compound is a stub. You can help Misplaced Pages by expanding it.